(R)-1-([1,1'-biphenyl]-4-ylmethyl)-7-(3-aminopyrrolidin-1-yl)-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA4530821

PubChem CID: 155546084

Max Phase: Preclinical

Molecular Formula: C27H24FN3O3

Molecular Weight: 457.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H]1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3Cc2ccc(-c3ccccc3)cc2)C1

Standard InChI:  InChI=1S/C27H24FN3O3/c28-23-12-21-24(13-25(23)30-11-10-20(29)15-30)31(16-22(26(21)32)27(33)34)14-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-9,12-13,16,20H,10-11,14-15,29H2,(H,33,34)/t20-/m1/s1

Standard InChI Key:  VLNLXOAMDBIVHK-HXUWFJFHSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   26.6357   -2.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6345   -3.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3493   -3.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3475   -2.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0629   -2.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0617   -3.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7746   -3.7836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4933   -3.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4945   -2.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7769   -2.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7770   -1.3016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2100   -2.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9234   -2.5476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2119   -1.3084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7723   -4.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4856   -5.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4820   -5.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1944   -6.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9110   -5.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9107   -5.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1976   -4.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6231   -6.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6205   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3335   -7.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0496   -7.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0482   -6.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3345   -5.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9197   -3.7851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9210   -2.1335    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.1649   -3.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6124   -4.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0243   -4.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8313   -4.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7913   -3.9754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
  2 28  1  0
  1 29  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
 31 34  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4530821

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.51Molecular Weight (Monoisotopic): 457.1802AlogP: 4.09#Rotatable Bonds: 5
Polar Surface Area: 88.56Molecular Species: ZWITTERIONHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.83CX Basic pKa: 9.63CX LogP: 1.88CX LogD: 1.88
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -0.86

References

1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ..  (2019)  Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone.,  172  [PMID:30959322] [10.1016/j.ejmech.2019.03.040]

Source