The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-fluoro-4-(2-oxo-4-(2-phenylacetamido)pyridin-1(2H)-yl)butyl)-N-(3-(trifluoromethoxy)benzyl)-1H-1,2,3-triazole-4-carboxamide ID: ALA4530893
PubChem CID: 118622521
Max Phase: Preclinical
Molecular Formula: C28H26F4N6O4
Molecular Weight: 586.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccc1)Nc1ccn(CC(F)CCn2cc(C(=O)NCc3cccc(OC(F)(F)F)c3)nn2)c(=O)c1
Standard InChI: InChI=1S/C28H26F4N6O4/c29-21(17-37-11-10-22(15-26(37)40)34-25(39)14-19-5-2-1-3-6-19)9-12-38-18-24(35-36-38)27(41)33-16-20-7-4-8-23(13-20)42-28(30,31)32/h1-8,10-11,13,15,18,21H,9,12,14,16-17H2,(H,33,41)(H,34,39)
Standard InChI Key: OXNHPVJQBJQVDS-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
6.7013 -21.3944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5185 -21.3944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7729 -20.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1099 -20.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4512 -20.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2066 -20.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2055 -21.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9135 -21.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6232 -21.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6204 -20.6284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9118 -20.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3265 -20.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0358 -20.6230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7420 -20.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4773 -20.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1886 -20.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8927 -20.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6039 -20.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3081 -20.1781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0191 -20.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7227 -20.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7160 -19.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9998 -18.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2991 -19.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4196 -18.9351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1314 -19.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8349 -18.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1396 -20.1538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5467 -19.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5527 -20.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2637 -20.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9682 -20.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9573 -19.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2458 -18.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5866 -18.9648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7389 -19.3946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4988 -20.2236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4986 -19.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7908 -18.9979 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2063 -18.9976 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4941 -18.5890 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8856 -19.3733 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 5 1 0
3 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 19 1 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
24 35 2 0
14 36 2 0
6 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
17 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.55Molecular Weight (Monoisotopic): 586.1952AlogP: 3.88#Rotatable Bonds: 12Polar Surface Area: 120.14Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.77CX Basic pKa: ┄CX LogP: 3.64CX LogD: 3.64Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.75
References 1. Zimmermann SC, Duvall B, Tsukamoto T.. (2018) Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase., 62 (1): [PMID:29969024 ] [10.1021/acs.jmedchem.8b00327 ]