sodium N1-methyl-N2-(16-(2-(methylamino)-2-oxoacetamido)hexadec-11(Z)-enoyl)glycinate

ID: ALA4530945

PubChem CID: 155546049

Max Phase: Preclinical

Molecular Formula: C22H38N3NaO5

Molecular Weight: 425.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)C(=O)NCCCC/C=C\CCCCCCCCCC(=O)N(C)CC(=O)[O-].[Na+]

Standard InChI:  InChI=1S/C22H39N3O5.Na/c1-23-21(29)22(30)24-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19(26)25(2)18-20(27)28;/h7,9H,3-6,8,10-18H2,1-2H3,(H,23,29)(H,24,30)(H,27,28);/q;+1/p-1/b9-7-;

Standard InChI Key:  SGHHTDFBNLJTQG-VILQZVERSA-M

Molfile:  

     RDKit          2D

 31 29  0  0  0  0  0  0  0  0999 V2000
   12.2744  -13.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0916  -13.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8658  -14.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0486  -14.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6400  -14.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0486  -15.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5002  -14.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3174  -14.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8658  -15.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2744  -14.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0916  -14.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5002  -15.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3174  -15.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7260  -16.4135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431  -16.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9517  -17.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9517  -15.7058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7689  -17.1213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1775  -17.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7260  -13.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431  -13.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9517  -12.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7689  -12.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431  -12.1673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9517  -11.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431  -10.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9517  -10.0442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7260  -10.7519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7260  -12.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431  -17.8290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6458  -11.5356    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  2  7  1  0
  7  8  1  0
  6  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 24 29  1  0
 16 30  2  0
M  CHG  2  28  -1  31   1
M  END

Associated Targets(Human)

EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.57Molecular Weight (Monoisotopic): 425.2890AlogP: 2.63#Rotatable Bonds: 17
Polar Surface Area: 115.81Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.12CX Basic pKa: CX LogP: 2.66CX LogD: -0.42
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.19Np Likeness Score: -0.24

References

1. Adebesin AM, Wesser T, Vijaykumar J, Konkel A, Paudyal MP, Lossie J, Zhu C, Westphal C, Puli N, Fischer R, Schunck WH, Falck JR..  (2019)  Development of Robust 17(R),18(S)-Epoxyeicosatetraenoic Acid (17,18-EEQ) Analogues as Potential Clinical Antiarrhythmic Agents.,  62  (22): [PMID:31693857] [10.1021/acs.jmedchem.9b00952]

Source