The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium N1-methyl-N2-(16-(2-(methylamino)-2-oxoacetamido)hexadec-11(Z)-enoyl)glycinate ID: ALA4530945
PubChem CID: 155546049
Max Phase: Preclinical
Molecular Formula: C22H38N3NaO5
Molecular Weight: 425.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)C(=O)NCCCC/C=C\CCCCCCCCCC(=O)N(C)CC(=O)[O-].[Na+]
Standard InChI: InChI=1S/C22H39N3O5.Na/c1-23-21(29)22(30)24-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19(26)25(2)18-20(27)28;/h7,9H,3-6,8,10-18H2,1-2H3,(H,23,29)(H,24,30)(H,27,28);/q;+1/p-1/b9-7-;
Standard InChI Key: SGHHTDFBNLJTQG-VILQZVERSA-M
Molfile:
RDKit 2D
31 29 0 0 0 0 0 0 0 0999 V2000
12.2744 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0916 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8658 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0486 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6400 -14.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0486 -15.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5002 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3174 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8658 -15.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2744 -14.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0916 -14.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5002 -15.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3174 -15.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7260 -16.4135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5431 -16.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -17.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -15.7058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7689 -17.1213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1775 -17.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7260 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5431 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -12.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7689 -12.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5431 -12.1673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -11.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5431 -10.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9517 -10.0442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7260 -10.7519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7260 -12.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5431 -17.8290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6458 -11.5356 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
2 7 1 0
7 8 1 0
6 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
24 29 1 0
16 30 2 0
M CHG 2 28 -1 31 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.57Molecular Weight (Monoisotopic): 425.2890AlogP: 2.63#Rotatable Bonds: 17Polar Surface Area: 115.81Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.12CX Basic pKa: ┄CX LogP: 2.66CX LogD: -0.42Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.19Np Likeness Score: -0.24
References 1. Adebesin AM, Wesser T, Vijaykumar J, Konkel A, Paudyal MP, Lossie J, Zhu C, Westphal C, Puli N, Fischer R, Schunck WH, Falck JR.. (2019) Development of Robust 17(R),18(S)-Epoxyeicosatetraenoic Acid (17,18-EEQ) Analogues as Potential Clinical Antiarrhythmic Agents., 62 (22): [PMID:31693857 ] [10.1021/acs.jmedchem.9b00952 ]