Ethyl 1-(4-trifluoromethylbenzyl)-1H-indole-2-carboxylate

ID: ALA4531064

Cas Number: 866236-21-7

PubChem CID: 11581037

Max Phase: Preclinical

Molecular Formula: C19H16F3NO2

Molecular Weight: 347.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cc2ccccc2n1Cc1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C19H16F3NO2/c1-2-25-18(24)17-11-14-5-3-4-6-16(14)23(17)12-13-7-9-15(10-8-13)19(20,21)22/h3-11H,2,12H2,1H3

Standard InChI Key:  KIRMBIMJAZHQEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   30.5002  -21.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0555  -22.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0543  -23.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7624  -23.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7606  -22.2785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4692  -22.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4695  -23.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2524  -23.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7362  -23.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2520  -22.4292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5533  -23.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9502  -21.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1999  -20.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6507  -19.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8513  -19.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6041  -20.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1550  -21.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9622  -23.8022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9617  -22.3868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7794  -23.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1882  -24.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3005  -19.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5479  -18.4647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.5023  -19.4115    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.7185  -18.6509    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
  9 11  1  0
 10  1  1  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 18  1  0
 11 19  2  0
 18 20  1  0
 20 21  1  0
 15 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
M  END

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 347.34Molecular Weight (Monoisotopic): 347.1133AlogP: 4.89#Rotatable Bonds: 4
Polar Surface Area: 31.23Molecular Species: HBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.18CX LogD: 5.18
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.63Np Likeness Score: -1.35

References

1. Keček Plešec K, Urbančič D, Gobec M, Pekošak A, Tomašič T, Anderluh M, Mlinarič-Raščan I, Jakopin Ž..  (2016)  Identification of indole scaffold-based dual inhibitors of NOD1 and NOD2.,  24  (21): [PMID:27601373] [10.1016/j.bmc.2016.08.044]

Source