The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((R)-6-Amino-1-(4-((((S)-2'-(isopentyloxy)-[1,1'-binaphthalen]-2-yl)oxy)methyl)-1H-1,2,3-triazol-1-yl)hexan-2-yl)-5-oxopyrrolidine-2-carboxamide hydrochloride ID: ALA4531152
PubChem CID: 155546074
Max Phase: Preclinical
Molecular Formula: C39H47ClN6O4
Molecular Weight: 662.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCOc1ccc2ccccc2c1-c1c(OCc2cn(C[C@@H](CCCCN)NC(=O)[C@@H]3CCC(=O)N3)nn2)ccc2ccccc12.Cl
Standard InChI: InChI=1S/C39H46N6O4.ClH/c1-26(2)20-22-48-34-17-14-27-9-3-5-12-31(27)37(34)38-32-13-6-4-10-28(32)15-18-35(38)49-25-30-24-45(44-43-30)23-29(11-7-8-21-40)41-39(47)33-16-19-36(46)42-33;/h3-6,9-10,12-15,17-18,24,26,29,33H,7-8,11,16,19-23,25,40H2,1-2H3,(H,41,47)(H,42,46);1H/t29-,33+;/m1./s1
Standard InChI Key: UBIXVOFBOKNVRW-CGKOTPGWSA-N
Molfile:
RDKit 2D
50 54 0 0 0 0 0 0 0 0999 V2000
23.0285 -14.8988 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.5948 -11.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8867 -11.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0559 -11.6002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7636 -11.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4713 -11.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9843 -12.3769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8015 -12.3769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3929 -11.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7342 -11.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9012 -11.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6095 -11.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6047 -10.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8956 -9.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9029 -12.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9039 -14.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6131 -13.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6083 -12.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3188 -11.6057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0249 -11.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3134 -12.4159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0237 -12.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0288 -13.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7390 -14.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7442 -14.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4442 -13.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1790 -11.1916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8867 -12.4174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4713 -12.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1790 -12.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1790 -13.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8867 -14.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8867 -14.8690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1927 -11.2036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1953 -10.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4904 -9.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7825 -10.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7838 -11.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4893 -11.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1958 -13.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1942 -12.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4862 -12.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7792 -12.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7847 -13.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4933 -14.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3788 -11.4209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8418 -10.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3444 -10.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5741 -10.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6587 -10.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
5 6 1 0
7 8 2 0
8 4 1 0
4 9 1 0
9 10 2 0
10 7 1 0
11 34 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 35 1 0
11 15 1 0
15 41 2 0
40 16 2 0
16 17 1 0
17 18 2 0
18 15 1 0
12 19 1 0
19 20 1 0
20 10 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
6 27 1 0
27 3 1 0
3 28 2 0
6 29 1 6
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 34 2 0
40 41 1 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
2 3 1 6
2 46 1 0
46 47 1 0
47 48 1 0
48 49 1 0
49 2 1 0
47 50 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 662.84Molecular Weight (Monoisotopic): 662.3581AlogP: 6.15#Rotatable Bonds: 16Polar Surface Area: 133.39Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.21CX Basic pKa: 10.14CX LogP: 5.14CX LogD: 2.79Aromatic Rings: 5Heavy Atoms: 49QED Weighted: 0.11Np Likeness Score: -0.37
References 1. Tague AJ, Putsathit P, Hammer KA, Wales SM, Knight DR, Riley TV, Keller PA, Pyne SG.. (2019) Cationic biaryl 1,2,3-triazolyl peptidomimetic amphiphiles: synthesis, antibacterial evaluation and preliminary mechanism of action studies., 168 [PMID:30831407 ] [10.1016/j.ejmech.2019.02.013 ]