(6-((4'-Chlorobiphenyl-4-ylmethyl)(pyridin-3-ylsulfonyl)-aminomethyl)pyridin-2-ylamino)acetic Acid Hydrochloride

ID: ALA4531171

PubChem CID: 66717319

Max Phase: Preclinical

Molecular Formula: C26H24Cl2N4O4S

Molecular Weight: 523.01

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(O)CNc1cccc(CN(Cc2ccc(-c3ccc(Cl)cc3)cc2)S(=O)(=O)c2cccnc2)n1

Standard InChI:  InChI=1S/C26H23ClN4O4S.ClH/c27-22-12-10-21(11-13-22)20-8-6-19(7-9-20)17-31(36(34,35)24-4-2-14-28-15-24)18-23-3-1-5-25(30-23)29-16-26(32)33;/h1-15H,16-18H2,(H,29,30)(H,32,33);1H

Standard InChI Key:  HCSFXOFJDHJHFQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    8.9571  -18.6804    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.9249  -20.2205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0999  -20.2205    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.5124  -20.9349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9610  -20.6414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9599  -21.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6747  -21.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3911  -21.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3882  -20.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6729  -20.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0980  -19.3975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8110  -18.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3821  -18.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3789  -18.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5269  -19.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0936  -17.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6590  -16.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6654  -17.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5252  -20.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404  -20.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9543  -20.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9486  -19.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2328  -18.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3743  -16.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0878  -16.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8001  -16.5065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5167  -16.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2290  -16.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9456  -16.9074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2244  -15.6737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6693  -20.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6721  -21.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3879  -21.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1012  -21.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0943  -20.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3781  -20.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8183  -21.8471    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 25  1  0
 24 17  1  0
 17 18  2  0
 18 14  1  0
 15 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 21 31  1  0
 34 37  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.01Molecular Weight (Monoisotopic): 522.1129AlogP: 4.68#Rotatable Bonds: 10
Polar Surface Area: 112.49Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.06CX Basic pKa: 5.67CX LogP: 1.90CX LogD: 0.59
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.54

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source