The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(2-(4-chloro-2,5-dimethoxyphenylamino)-5-(trifluoromethyl)pyrimidin-4-yl)isoindolin-4-yl)-N-methylmethanesulfonamide ID: ALA4531245
PubChem CID: 155546111
Max Phase: Preclinical
Molecular Formula: C23H23ClF3N5O4S
Molecular Weight: 557.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2ncc(C(F)(F)F)c(N3Cc4cccc(N(C)S(C)(=O)=O)c4C3)n2)c(OC)cc1Cl
Standard InChI: InChI=1S/C23H23ClF3N5O4S/c1-31(37(4,33)34)18-7-5-6-13-11-32(12-14(13)18)21-15(23(25,26)27)10-28-22(30-21)29-17-9-19(35-2)16(24)8-20(17)36-3/h5-10H,11-12H2,1-4H3,(H,28,29,30)
Standard InChI Key: OZJUQZXGEMVFBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
10.5740 -9.6784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3635 -10.4708 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.1550 -10.2569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9141 -9.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9130 -10.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6210 -10.9233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3307 -10.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3278 -9.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6192 -9.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0395 -10.9190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1263 -11.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7855 -10.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3334 -11.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9274 -11.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3355 -12.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1493 -12.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5534 -11.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1430 -11.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0352 -9.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6777 -8.9035 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8346 -9.5782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.1683 -8.4342 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2049 -10.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5474 -10.4778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7774 -11.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1346 -9.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2043 -11.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4961 -12.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4952 -12.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2031 -13.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9135 -12.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9110 -12.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7892 -11.7362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7907 -10.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6223 -13.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6245 -14.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2035 -14.1897 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 14 1 0
13 12 1 0
12 10 1 0
7 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 1 0
19 21 1 0
19 22 1 0
8 19 1 0
5 23 1 0
18 24 1 0
24 2 1 0
2 25 1 0
24 26 1 0
23 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
28 33 1 0
33 34 1 0
31 35 1 0
35 36 1 0
30 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.98Molecular Weight (Monoisotopic): 557.1111AlogP: 4.83#Rotatable Bonds: 7Polar Surface Area: 96.89Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.17CX Basic pKa: 3.45CX LogP: 4.11CX LogD: 4.11Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -1.45
References 1. Choi MJ, Roh EJ, Hur W, Lee SH, Sim T, Oh CH, Lee SH, Kim JS, Yoo KH.. (2018) Design, synthesis, and biological evaluation of novel aminopyrimidinylisoindolines as AXL kinase inhibitors., 28 (23-24): [PMID:30340900 ] [10.1016/j.bmcl.2018.10.013 ]