The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(Benzo[d]thiazol-2-ylthio)-2-(prop-2-yn-1-ylthio)-6-(3,4,5-trimethoxyphenyl)pyrimidine-5-carbonitrile ID: ALA4531251
PubChem CID: 155546159
Max Phase: Preclinical
Molecular Formula: C24H18N4O3S3
Molecular Weight: 506.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCSc1nc(Sc2nc3ccccc3s2)c(C#N)c(-c2cc(OC)c(OC)c(OC)c2)n1
Standard InChI: InChI=1S/C24H18N4O3S3/c1-5-10-32-23-27-20(14-11-17(29-2)21(31-4)18(12-14)30-3)15(13-25)22(28-23)34-24-26-16-8-6-7-9-19(16)33-24/h1,6-9,11-12H,10H2,2-4H3
Standard InChI Key: XHBZXWWYILGQRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
25.4677 -4.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4666 -5.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1746 -5.6983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8843 -5.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8814 -4.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1728 -4.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7585 -5.6973 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.0512 -5.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3431 -5.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5876 -4.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1704 -3.2437 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5926 -5.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2915 -3.6424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6350 -6.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5891 -6.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2966 -6.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0046 -6.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0007 -5.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2926 -5.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7063 -5.2779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7135 -6.9180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2975 -7.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5902 -8.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7159 -7.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4161 -5.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4615 -2.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3712 -2.0212 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.7136 -3.1682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1649 -2.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5726 -1.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1614 -1.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3426 -1.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9367 -1.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3503 -2.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
5 10 1 0
6 11 1 0
4 12 1 0
10 13 3 0
9 14 3 0
12 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 12 1 0
18 20 1 0
17 21 1 0
16 22 1 0
22 23 1 0
21 24 1 0
20 25 1 0
11 26 1 0
26 27 1 0
27 30 1 0
29 28 1 0
28 26 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.63Molecular Weight (Monoisotopic): 506.0541AlogP: 5.53#Rotatable Bonds: 8Polar Surface Area: 90.15Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.62CX LogP: 6.50CX LogD: 6.50Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: -1.46
References 1. Zhou W, Ma L, Ding L, Guo Q, He Z, Yang J, Qiao H, Li L, Yang J, Yu S, Zhao L, Wang S, Liu HM, Suo Z, Zhao W.. (2019) Potent 5-Cyano-6-phenyl-pyrimidin-Based Derivatives Targeting DCN1-UBE2M Interaction., 62 (11): [PMID:31157974 ] [10.1021/acs.jmedchem.9b00003 ]