The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 3-(3-((1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-ylamino)methyl)phenyl)acrylate ID: ALA4531392
PubChem CID: 155546275
Max Phase: Preclinical
Molecular Formula: C31H29N3O5
Molecular Weight: 523.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C=C/c1cccc(CNc2cc3c([nH]c4ccccc43)c(-c3cc(OC)c(OC)c(OC)c3)n2)c1
Standard InChI: InChI=1S/C31H29N3O5/c1-36-25-15-21(16-26(37-2)31(25)39-4)29-30-23(22-10-5-6-11-24(22)33-30)17-27(34-29)32-18-20-9-7-8-19(14-20)12-13-28(35)38-3/h5-17,33H,18H2,1-4H3,(H,32,34)/b13-12+
Standard InChI Key: BXGJVCUGBLLDEY-OUKQBFOZSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
7.4540 -13.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4537 -14.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1721 -14.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8890 -14.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8833 -13.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1644 -13.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6088 -14.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3201 -14.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0399 -14.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0440 -15.4962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3089 -17.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0286 -16.7533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0256 -15.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3071 -15.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7417 -15.5051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5910 -16.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5876 -15.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8049 -17.0153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3184 -16.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8004 -15.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -14.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6472 -14.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1666 -15.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5029 -16.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7407 -14.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3106 -17.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5954 -18.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5949 -19.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3087 -19.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0247 -19.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0217 -18.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7395 -19.6323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3097 -20.4629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5966 -20.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7422 -20.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8811 -19.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1679 -19.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7516 -14.2532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4668 -14.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
16 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 17 1 0
13 15 1 0
16 17 2 0
17 20 1 0
19 18 1 0
18 16 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
15 25 1 0
25 2 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
11 26 1 0
30 32 1 0
29 33 1 0
33 34 1 0
32 35 1 0
28 36 1 0
36 37 1 0
9 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.59Molecular Weight (Monoisotopic): 523.2107AlogP: 6.21#Rotatable Bonds: 9Polar Surface Area: 94.70Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.76CX LogP: 5.77CX LogD: 5.76Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.03
References 1. Ling Y, Gao WJ, Ling C, Liu J, Meng C, Qian J, Liu S, Gan H, Wu H, Tao J, Dai H, Zhang Y.. (2019) β-Carboline and N-hydroxycinnamamide hybrids as anticancer agents for drug-resistant hepatocellular carcinoma., 168 [PMID:30851694 ] [10.1016/j.ejmech.2019.02.054 ]