methyl 3-(3-((1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-ylamino)methyl)phenyl)acrylate

ID: ALA4531392

PubChem CID: 155546275

Max Phase: Preclinical

Molecular Formula: C31H29N3O5

Molecular Weight: 523.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)/C=C/c1cccc(CNc2cc3c([nH]c4ccccc43)c(-c3cc(OC)c(OC)c(OC)c3)n2)c1

Standard InChI:  InChI=1S/C31H29N3O5/c1-36-25-15-21(16-26(37-2)31(25)39-4)29-30-23(22-10-5-6-11-24(22)33-30)17-27(34-29)32-18-20-9-7-8-19(14-20)12-13-28(35)38-3/h5-17,33H,18H2,1-4H3,(H,32,34)/b13-12+

Standard InChI Key:  BXGJVCUGBLLDEY-OUKQBFOZSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    7.4540  -13.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4537  -14.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1721  -14.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8890  -14.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8833  -13.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1644  -13.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6088  -14.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3201  -14.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0399  -14.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0440  -15.4962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3089  -17.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0286  -16.7533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0256  -15.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3071  -15.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7417  -15.5051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5910  -16.7537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5876  -15.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8049  -17.0153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3184  -16.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8004  -15.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4667  -14.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6472  -14.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1666  -15.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5029  -16.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407  -14.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3106  -17.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5954  -18.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5949  -19.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3087  -19.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0247  -19.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0217  -18.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7395  -19.6323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3097  -20.4629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5966  -20.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7422  -20.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8811  -19.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1679  -19.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7516  -14.2532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4668  -14.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 16 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 17  1  0
 13 15  1  0
 16 17  2  0
 17 20  1  0
 19 18  1  0
 18 16  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 15 25  1  0
 25  2  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 11 26  1  0
 30 32  1  0
 29 33  1  0
 33 34  1  0
 32 35  1  0
 28 36  1  0
 36 37  1  0
  9 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531392

    ---

Associated Targets(Human)

Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bel7402/5-FU (373 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.59Molecular Weight (Monoisotopic): 523.2107AlogP: 6.21#Rotatable Bonds: 9
Polar Surface Area: 94.70Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.76CX LogP: 5.77CX LogD: 5.76
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.03

References

1. Ling Y, Gao WJ, Ling C, Liu J, Meng C, Qian J, Liu S, Gan H, Wu H, Tao J, Dai H, Zhang Y..  (2019)  β-Carboline and N-hydroxycinnamamide hybrids as anticancer agents for drug-resistant hepatocellular carcinoma.,  168  [PMID:30851694] [10.1016/j.ejmech.2019.02.054]

Source