N-(3-(1H-Imidazol-1-yl)propyl)-6-(4-methoxy-3-methylphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine

ID: ALA4531413

PubChem CID: 153370141

Max Phase: Preclinical

Molecular Formula: C25H24N6O2

Molecular Weight: 440.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCCn4ccnc4)c3c2)cc1C

Standard InChI:  InChI=1S/C25H24N6O2/c1-17-12-18(5-7-23(17)32-2)19-4-6-22-20(13-19)24(21(14-28-22)25-30-29-16-33-25)27-8-3-10-31-11-9-26-15-31/h4-7,9,11-16H,3,8,10H2,1-2H3,(H,27,28)

Standard InChI Key:  BMUWIAGEPMSJBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    5.0008  -14.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9996  -15.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7077  -15.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7059  -13.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4145  -14.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4153  -15.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1238  -15.4119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8321  -15.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8273  -14.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1182  -13.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5317  -13.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2802  -14.0914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8233  -13.4808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4104  -12.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6122  -12.9504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1139  -12.9584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4040  -12.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2951  -13.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2962  -12.9628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5892  -12.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8806  -12.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8835  -13.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5910  -14.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3997  -11.7363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6898  -11.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6855  -10.5143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3405  -10.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0839   -9.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2666   -9.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0183  -10.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1773  -14.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1723  -12.5558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1710  -11.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 10 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 22 31  1  0
 21 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531413

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.51Molecular Weight (Monoisotopic): 440.1961AlogP: 4.97#Rotatable Bonds: 8
Polar Surface Area: 90.89Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.00CX LogP: 2.58CX LogD: 2.44
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.39

References

1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A..  (2019)  Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity.,  62  (7): [PMID:30897325] [10.1021/acs.jmedchem.8b01938]

Source