The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1'-(8-bromooctyl)-5'-chloro-3-((S)-1-(4-chlorophenyl)ethyl)-4,6-dihydrospiro[[1,2,3]triazolo[4,5-b]pyridine-7,3'-indoline]-2',5(3H)-dione ID: ALA4531468
PubChem CID: 155546634
Max Phase: Preclinical
Molecular Formula: C28H30BrCl2N5O2
Molecular Weight: 619.39
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](c1ccc(Cl)cc1)n1nnc2c1NC(=O)C[C@]21C(=O)N(CCCCCCCCBr)c2ccc(Cl)cc21
Standard InChI: InChI=1S/C28H30BrCl2N5O2/c1-18(19-8-10-20(30)11-9-19)36-26-25(33-34-36)28(17-24(37)32-26)22-16-21(31)12-13-23(22)35(27(28)38)15-7-5-3-2-4-6-14-29/h8-13,16,18H,2-7,14-15,17H2,1H3,(H,32,37)/t18-,28+/m0/s1
Standard InChI Key: SEOYLKVAZIJOJM-XDBZFTIUSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
20.8379 -25.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6367 -26.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6355 -27.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3477 -27.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3459 -25.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0587 -26.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0634 -27.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8476 -27.3126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3250 -26.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1285 -24.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1285 -25.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8379 -24.3341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5473 -24.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5518 -25.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3311 -25.8160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8058 -25.1509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3239 -24.4913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1463 -26.6386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4155 -24.3403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9247 -25.8325 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.0258 -24.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0191 -23.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7410 -24.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7306 -22.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7242 -22.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0085 -21.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3018 -22.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3117 -22.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0007 -20.7962 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.8425 -28.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5476 -28.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2579 -28.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9630 -28.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6733 -28.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3784 -28.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0887 -28.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7938 -28.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7887 -29.3839 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
1 9 1 1
1 6 1 0
10 11 1 0
10 12 1 0
11 1 1 0
1 14 1 0
13 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
9 18 2 0
10 19 2 0
2 20 1 0
17 21 1 0
21 22 1 0
21 23 1 6
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
26 29 1 0
8 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 619.39Molecular Weight (Monoisotopic): 617.0960AlogP: 6.90#Rotatable Bonds: 10Polar Surface Area: 80.12Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.06CX Basic pKa: ┄CX LogP: 6.83CX LogD: 6.83Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.86
References 1. Xu J, Xie X, Ye N, Zou J, Chen H, White MA, Shi PY, Zhou J.. (2019) Design, Synthesis, and Biological Evaluation of Substituted 4,6-Dihydrospiro[[1,2,3]triazolo[4,5-b ]pyridine-7,3'-indoline]-2',5(3H )-dione Analogues as Potent NS4B Inhibitors for the Treatment of Dengue Virus Infection., 62 (17): [PMID:31403780 ] [10.1021/acs.jmedchem.9b00698 ]