The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{2-[(2-Allylsulfanyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-4-oxothiazolidin-5-yl}acetic acid ID: ALA4531498
PubChem CID: 155546454
Max Phase: Preclinical
Molecular Formula: C19H16N6O3S3
Molecular Weight: 472.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCSc1nn2c(/C=N/N=C3/NC(=O)C(CC(=O)O)S3)c(-c3ccccc3)nc2s1
Standard InChI: InChI=1S/C19H16N6O3S3/c1-2-8-29-19-24-25-12(15(21-18(25)31-19)11-6-4-3-5-7-11)10-20-23-17-22-16(28)13(30-17)9-14(26)27/h2-7,10,13H,1,8-9H2,(H,26,27)(H,22,23,28)/b20-10+
Standard InChI Key: PLMLHBZQTOSLBG-KEBDBYFISA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
35.8326 -16.1984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8142 -14.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3432 -15.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6055 -15.1040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6146 -15.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4031 -16.1792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.8828 -15.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3883 -14.8414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5222 -15.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0980 -14.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2731 -14.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8715 -15.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2965 -16.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1201 -16.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5487 -14.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7385 -13.9192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4729 -13.1376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6626 -12.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3106 -12.2327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4907 -12.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3320 -13.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0537 -13.5412 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9318 -11.7244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5823 -13.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9063 -13.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1609 -13.3593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9509 -12.1913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7045 -15.4957 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.1073 -14.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9288 -14.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3317 -14.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
20 23 2 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
7 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.58Molecular Weight (Monoisotopic): 472.0446AlogP: 3.13#Rotatable Bonds: 8Polar Surface Area: 121.31Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.63CX Basic pKa: 1.67CX LogP: 3.99CX LogD: 0.60Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.22Np Likeness Score: -1.61
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]