{2-[(2-Allylsulfanyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-4-oxothiazolidin-5-yl}acetic acid

ID: ALA4531498

PubChem CID: 155546454

Max Phase: Preclinical

Molecular Formula: C19H16N6O3S3

Molecular Weight: 472.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCSc1nn2c(/C=N/N=C3/NC(=O)C(CC(=O)O)S3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C19H16N6O3S3/c1-2-8-29-19-24-25-12(15(21-18(25)31-19)11-6-4-3-5-7-11)10-20-23-17-22-16(28)13(30-17)9-14(26)27/h2-7,10,13H,1,8-9H2,(H,26,27)(H,22,23,28)/b20-10+

Standard InChI Key:  PLMLHBZQTOSLBG-KEBDBYFISA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   35.8326  -16.1984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8142  -14.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3432  -15.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6055  -15.1040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6146  -15.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4031  -16.1792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.8828  -15.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3883  -14.8414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5222  -15.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0980  -14.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2731  -14.8479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8715  -15.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2965  -16.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1201  -16.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5487  -14.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7385  -13.9192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4729  -13.1376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6626  -12.9788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3106  -12.2327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4907  -12.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3320  -13.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0537  -13.5412    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.9318  -11.7244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5823  -13.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9063  -13.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1609  -13.3593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9509  -12.1913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7045  -15.4957    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.1073  -14.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9288  -14.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3317  -14.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  2  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
  7 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4531498

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.58Molecular Weight (Monoisotopic): 472.0446AlogP: 3.13#Rotatable Bonds: 8
Polar Surface Area: 121.31Molecular Species: ACIDHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.63CX Basic pKa: 1.67CX LogP: 3.99CX LogD: 0.60
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.22Np Likeness Score: -1.61

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source