The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dimethoxy-N-(4-methoxyphenyl)phenylsulfonamido)-N-(1-phenylethyl)acetamide ID: ALA4531556
PubChem CID: 2860019
Max Phase: Preclinical
Molecular Formula: C25H28N2O6S
Molecular Weight: 484.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(CC(=O)NC(C)c2ccccc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1
Standard InChI: InChI=1S/C25H28N2O6S/c1-18(19-8-6-5-7-9-19)26-25(28)17-27(20-10-12-21(31-2)13-11-20)34(29,30)22-14-15-23(32-3)24(16-22)33-4/h5-16,18H,17H2,1-4H3,(H,26,28)
Standard InChI Key: JEAMDNZXOGZFSZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
17.4458 -14.6888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0413 -13.9831 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.6324 -14.6862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4570 -13.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1647 -13.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8724 -13.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1647 -12.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5801 -13.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2878 -13.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5801 -12.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2855 -14.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9924 -15.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7011 -14.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6984 -13.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9910 -13.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7493 -13.5745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7493 -12.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3338 -13.5745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3390 -12.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6321 -12.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9234 -12.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9261 -13.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6335 -13.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4604 -12.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4607 -11.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7525 -11.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0424 -11.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0455 -12.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7514 -10.3094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4585 -9.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2152 -12.3487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2141 -11.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2198 -13.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5106 -13.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
5 7 2 0
6 8 1 0
8 9 1 0
8 10 1 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
4 16 1 0
16 2 1 0
16 17 1 0
2 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
17 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 17 1 0
26 29 1 0
29 30 1 0
21 31 1 0
31 32 1 0
22 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.57Molecular Weight (Monoisotopic): 484.1668AlogP: 3.79#Rotatable Bonds: 10Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.99CX Basic pKa: ┄CX LogP: 3.25CX LogD: 3.25Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.48
References 1. Turku A, Borrel A, Leino TO, Karhu L, Kukkonen JP, Xhaard H.. (2016) Pharmacophore Model To Discover OX1 and OX2 Orexin Receptor Ligands., 59 (18): [PMID:27546834 ] [10.1021/acs.jmedchem.6b00333 ]