(E)-(((7-Hydroxy-6-methylhept-5-en-1-yl)phosphoryl)bis-(oxy))bis(methylene)bis(2,2-dimethylpropanoate)

ID: ALA4531623

PubChem CID: 155546594

Max Phase: Preclinical

Molecular Formula: C20H37O8P

Molecular Weight: 436.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\CCCCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)CO

Standard InChI:  InChI=1S/C20H37O8P/c1-16(13-21)11-9-8-10-12-29(24,27-14-25-17(22)19(2,3)4)28-15-26-18(23)20(5,6)7/h11,21H,8-10,12-15H2,1-7H3/b16-11+

Standard InChI Key:  YKOFLJHBCQQVQI-LFIBNONCSA-N

Molfile:  

 
     RDKit          2D

 29 28  0  0  0  0  0  0  0  0999 V2000
    5.1219  -18.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8337  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5456  -18.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2574  -17.8957    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.9692  -18.3043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2574  -17.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2515  -18.7129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5456  -16.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5456  -15.8403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8337  -15.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8337  -14.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1219  -15.8403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5456  -14.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1219  -14.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8276  -13.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6811  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3888  -18.3043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1006  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8124  -18.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1006  -17.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8124  -19.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5243  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5191  -18.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4101  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6982  -18.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9905  -17.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9905  -17.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2787  -18.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5668  -17.8957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  4  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 11 14  1  0
 11 15  1  0
  5 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 19 22  1  0
 19 23  1  0
  1 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531623

    ---

Associated Targets(Human)

BTN3A1 Tchem Butyrophilin subfamily 3 member A1 (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.48Molecular Weight (Monoisotopic): 436.2226AlogP: 4.42#Rotatable Bonds: 12
Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.61CX LogD: 4.61
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.16Np Likeness Score: 0.96

References

1. Poe MM, Agabiti SS, Liu C, Li V, Teske KA, Hsiao CC, Wiemer AJ..  (2019)  Probing the Ligand-Binding Pocket of BTN3A1.,  62  (14): [PMID:31268699] [10.1021/acs.jmedchem.9b00825]

Source