The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-(((7-Hydroxy-6-methylhept-5-en-1-yl)phosphoryl)bis-(oxy))bis(methylene)bis(2,2-dimethylpropanoate) ID: ALA4531623
PubChem CID: 155546594
Max Phase: Preclinical
Molecular Formula: C20H37O8P
Molecular Weight: 436.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\CCCCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)CO
Standard InChI: InChI=1S/C20H37O8P/c1-16(13-21)11-9-8-10-12-29(24,27-14-25-17(22)19(2,3)4)28-15-26-18(23)20(5,6)7/h11,21H,8-10,12-15H2,1-7H3/b16-11+
Standard InChI Key: YKOFLJHBCQQVQI-LFIBNONCSA-N
Molfile:
RDKit 2D
29 28 0 0 0 0 0 0 0 0999 V2000
5.1219 -18.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8337 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5456 -18.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2574 -17.8957 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.9692 -18.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2574 -17.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2515 -18.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5456 -16.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5456 -15.8403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8337 -15.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8337 -14.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1219 -15.8403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5456 -14.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1219 -14.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8276 -13.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6811 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3888 -18.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1006 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8124 -18.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1006 -17.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8124 -19.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5243 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5191 -18.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4101 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6982 -18.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9905 -17.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9905 -17.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2787 -18.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5668 -17.8957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 0
4 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
11 14 1 0
11 15 1 0
5 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
19 23 1 0
1 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
26 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.48Molecular Weight (Monoisotopic): 436.2226AlogP: 4.42#Rotatable Bonds: 12Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.61CX LogD: 4.61Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.16Np Likeness Score: 0.96