The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-((1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylene-3-oxo-6-((E)-2-(2-oxo-2,5- dihydrofuran-3-yl)ethenyl)decahydro-1H-benzo[c]azepin-1-yl)methyl 2-amino-4-methylpentanoate ID: ALA4531651
PubChem CID: 155546305
Max Phase: Preclinical
Molecular Formula: C26H38N2O5
Molecular Weight: 458.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CC[C@H]2[C@@](C)(CCC(=O)N[C@@]2(C)COC(=O)[C@H](N)CC(C)C)[C@@H]1/C=C/C1=CCOC1=O
Standard InChI: InChI=1S/C26H38N2O5/c1-16(2)14-20(27)24(31)33-15-26(5)21-9-6-17(3)19(8-7-18-11-13-32-23(18)30)25(21,4)12-10-22(29)28-26/h7-8,11,16,19-21H,3,6,9-10,12-15,27H2,1-2,4-5H3,(H,28,29)/b8-7+/t19-,20-,21+,25+,26+/m1/s1
Standard InChI Key: PKIQAFCMXAIXJT-HZFOGSFHSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.4710 -15.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8932 -14.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6817 -15.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2423 -14.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9476 -14.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9476 -13.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2423 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5391 -13.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5370 -14.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8952 -13.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0926 -14.6815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0928 -13.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7385 -13.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7475 -15.1345 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.9213 -13.9416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5329 -12.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2422 -12.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9498 -11.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9496 -11.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6071 -10.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3544 -9.8128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5372 -9.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2849 -10.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3850 -10.8402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6565 -13.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 -15.4358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6968 -16.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5140 -16.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 -16.8513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9226 -16.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9226 -15.4358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7398 -16.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1484 -17.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1484 -16.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 7 1 0
9 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 9 1 0
9 2 1 0
8 10 1 0
2 11 1 0
10 12 1 0
11 13 1 0
12 13 1 0
9 14 1 1
13 15 2 0
8 16 1 6
7 17 1 6
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 19 2 0
20 24 2 0
6 25 2 0
2 3 1 1
2 1 1 0
1 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
28 31 1 6
30 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2781AlogP: 3.20#Rotatable Bonds: 7Polar Surface Area: 107.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.97CX Basic pKa: 7.39CX LogP: 3.01CX LogD: 2.71Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: 2.28
References 1. Wang W, Wu Y, Yang K, Wu C, Tang R, Li H, Chen L.. (2019) Synthesis of novel andrographolide beckmann rearrangement derivatives and evaluation of their HK2-related anti-inflammatory activities., 173 [PMID:31009914 ] [10.1016/j.ejmech.2019.04.022 ]