(R)-((1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylene-3-oxo-6-((E)-2-(2-oxo-2,5- dihydrofuran-3-yl)ethenyl)decahydro-1H-benzo[c]azepin-1-yl)methyl 2-amino-4-methylpentanoate

ID: ALA4531651

PubChem CID: 155546305

Max Phase: Preclinical

Molecular Formula: C26H38N2O5

Molecular Weight: 458.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@](C)(CCC(=O)N[C@@]2(C)COC(=O)[C@H](N)CC(C)C)[C@@H]1/C=C/C1=CCOC1=O

Standard InChI:  InChI=1S/C26H38N2O5/c1-16(2)14-20(27)24(31)33-15-26(5)21-9-6-17(3)19(8-7-18-11-13-32-23(18)30)25(21,4)12-10-22(29)28-26/h7-8,11,16,19-21H,3,6,9-10,12-15,27H2,1-2,4-5H3,(H,28,29)/b8-7+/t19-,20-,21+,25+,26+/m1/s1

Standard InChI Key:  PKIQAFCMXAIXJT-HZFOGSFHSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    3.4710  -15.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8932  -14.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6817  -15.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2423  -14.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9476  -14.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9476  -13.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2423  -13.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5391  -13.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5370  -14.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8952  -13.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0926  -14.6815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0928  -13.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7385  -13.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7475  -15.1345    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9213  -13.9416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5329  -12.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2422  -12.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9498  -11.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9496  -11.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6071  -10.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3544   -9.8128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5372   -9.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2849  -10.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3850  -10.8402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6565  -13.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2882  -15.4358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6968  -16.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5140  -16.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2882  -16.8513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9226  -16.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9226  -15.4358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7398  -16.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1484  -17.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1484  -16.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  7  1  0
  9  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  1  0
  9  2  1  0
  8 10  1  0
  2 11  1  0
 10 12  1  0
 11 13  1  0
 12 13  1  0
  9 14  1  1
 13 15  2  0
  8 16  1  6
  7 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
 20 24  2  0
  6 25  2  0
  2  3  1  1
  2  1  1  0
  1 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 28 31  1  6
 30 32  1  0
 32 33  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531651

    ---

Associated Targets(Human)

HK2 Tchem Hexokinase type II (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2781AlogP: 3.20#Rotatable Bonds: 7
Polar Surface Area: 107.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.97CX Basic pKa: 7.39CX LogP: 3.01CX LogD: 2.71
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: 2.28

References

1. Wang W, Wu Y, Yang K, Wu C, Tang R, Li H, Chen L..  (2019)  Synthesis of novel andrographolide beckmann rearrangement derivatives and evaluation of their HK2-related anti-inflammatory activities.,  173  [PMID:31009914] [10.1016/j.ejmech.2019.04.022]

Source