The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3-cyclopentyloxy-4-methoxybenzylidene)-3-(4-(4-(2,3-dichlorophenyl)piperazine-1-yl)butyl)-imidazolidine-2,4-dione ID: ALA4531761
PubChem CID: 155546595
Max Phase: Preclinical
Molecular Formula: C30H36Cl2N4O4
Molecular Weight: 587.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\NC(=O)N(CCCCN3CCN(c4cccc(Cl)c4Cl)CC3)C2=O)cc1OC1CCCC1
Standard InChI: InChI=1S/C30H36Cl2N4O4/c1-39-26-12-11-21(20-27(26)40-22-7-2-3-8-22)19-24-29(37)36(30(38)33-24)14-5-4-13-34-15-17-35(18-16-34)25-10-6-9-23(31)28(25)32/h6,9-12,19-20,22H,2-5,7-8,13-18H2,1H3,(H,33,38)/b24-19-
Standard InChI Key: JRGUQARZOWLZRD-CLCOLTQESA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
18.5422 -28.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5411 -29.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2491 -29.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9588 -29.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9560 -28.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2473 -28.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8330 -29.7467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1257 -29.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8344 -28.1107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8342 -27.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6621 -28.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3751 -28.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3744 -29.3274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1521 -29.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6334 -28.9194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1531 -28.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4062 -27.4805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4040 -30.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4506 -28.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8597 -28.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6769 -28.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0860 -27.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9032 -27.5064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3080 -28.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1216 -28.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5345 -27.5112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1277 -26.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3079 -26.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3517 -27.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7523 -28.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5688 -28.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9814 -27.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5716 -26.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7565 -26.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4984 -26.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2456 -26.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4284 -26.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1762 -26.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3474 -26.1030 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.9809 -26.1036 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
14 18 2 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
10 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 10 1 0
34 39 1 0
33 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.55Molecular Weight (Monoisotopic): 586.2114AlogP: 5.82#Rotatable Bonds: 10Polar Surface Area: 74.35Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.60CX Basic pKa: 7.31CX LogP: 5.48CX LogD: 5.22Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -0.92
References 1. Czopek A, Bucki A, Kołaczkowski M, Zagórska A, Drop M, Pawłowski M, Siwek A, Głuch-Lutwin M, Pękala E, Chrzanowska A, Struga M, Partyka A, Wesołowska A.. (2019) Novel multitarget 5-arylidenehydantoins with arylpiperazinealkyl fragment: Pharmacological evaluation and investigation of cytotoxicity and metabolic stability., 27 (18): [PMID:31383628 ] [10.1016/j.bmc.2019.07.046 ]