N-(4-(2-methoxyethoxy)phenyl)-5-(6-(methylamino)pyrazin-2-yl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4531769

PubChem CID: 155546265

Max Phase: Preclinical

Molecular Formula: C26H25N7O3

Molecular Weight: 483.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1cncc(-c2c[nH]c3nc(Nc4ccc(OCCOC)cc4)nc(Oc4ccccc4)c23)n1

Standard InChI:  InChI=1S/C26H25N7O3/c1-27-22-16-28-15-21(31-22)20-14-29-24-23(20)25(36-19-6-4-3-5-7-19)33-26(32-24)30-17-8-10-18(11-9-17)35-13-12-34-2/h3-11,14-16H,12-13H2,1-2H3,(H,27,31)(H2,29,30,32,33)

Standard InChI Key:  ASDAIMAMFBTJEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   31.6255   -8.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6244   -9.6476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3324  -10.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3306   -8.4192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0393   -8.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0441   -9.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8241   -9.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3015   -9.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8163   -8.5671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9177   -8.4197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2101   -8.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5024   -8.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7953   -8.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7951   -9.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5078  -10.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2120   -9.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3335  -10.8738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6263  -11.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9213  -10.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2146  -11.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2152  -12.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9284  -12.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6322  -12.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0798  -10.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5348  -11.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7913  -12.0482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5924  -12.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1365  -11.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8771  -10.8260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9374  -11.7611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1971  -12.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0880  -10.0541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3796   -9.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6726  -10.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9642   -9.6489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2572  -10.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  7 24  1  0
 28 30  1  0
 30 31  1  0
 14 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531769

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.53Molecular Weight (Monoisotopic): 483.2019AlogP: 5.02#Rotatable Bonds: 10
Polar Surface Area: 119.10Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.86CX Basic pKa: 4.21CX LogP: 4.19CX LogD: 4.19
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.01

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source