(E)-1-ethyl-5-((1-methyl-1H-pyrrol-2-yl)methylene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

ID: ALA4531807

PubChem CID: 1606258

Max Phase: Preclinical

Molecular Formula: C12H13N3O2S

Molecular Weight: 263.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1C(=O)/C(=C/c2cccn2C)C(=O)NC1=S

Standard InChI:  InChI=1S/C12H13N3O2S/c1-3-15-11(17)9(10(16)13-12(15)18)7-8-5-4-6-14(8)2/h4-7H,3H2,1-2H3,(H,13,16,18)/b9-7+

Standard InChI Key:  OTCKMVDGIBNRAU-VQHVLOKHSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
    7.7653  -11.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4812  -10.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913  -11.1161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1917  -11.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4759  -12.3497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7596  -11.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0437  -12.3506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4764  -13.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1910  -13.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9098  -12.3534    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4859   -9.8755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0542  -10.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0605   -9.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7268   -9.3866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4763   -8.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6513   -8.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3869   -9.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5477   -9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  6  7  2  0
  5  8  1  0
  8  9  1  0
  4 10  2  0
  2 11  2  0
  1 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  2  0
 14 18  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 263.32Molecular Weight (Monoisotopic): 263.0728AlogP: 0.67#Rotatable Bonds: 2
Polar Surface Area: 54.34Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.69CX Basic pKa: CX LogP: 1.48CX LogD: 1.30
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.48Np Likeness Score: -1.92

References

1.  (2012)  Entpd5 inhibitors, 

Source