The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-benzyl-1-ethyl-3-(4-(trifluoromethyl)benzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione ID: ALA4531940
PubChem CID: 141753915
Max Phase: Preclinical
Molecular Formula: C24H24F3N3O2
Molecular Weight: 443.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c2c(c(=O)n(Cc3ccc(C(F)(F)F)cc3)c1=O)CN(Cc1ccccc1)CC2
Standard InChI: InChI=1S/C24H24F3N3O2/c1-2-29-21-12-13-28(14-17-6-4-3-5-7-17)16-20(21)22(31)30(23(29)32)15-18-8-10-19(11-9-18)24(25,26)27/h3-11H,2,12-16H2,1H3
Standard InChI Key: PCRPLOYFDONKHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
5.3860 -3.2935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3860 -4.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0913 -4.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0913 -2.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7966 -3.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7931 -4.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2087 -3.2995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5021 -2.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2052 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4957 -4.5206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5045 -2.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9185 -2.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6771 -2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9706 -3.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2623 -2.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5563 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5582 -4.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2721 -4.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9752 -4.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9108 -4.5290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4914 -5.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7815 -5.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6241 -3.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6176 -4.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3224 -4.5364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0332 -4.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0349 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3296 -2.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7428 -4.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3853 -4.9174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8758 -5.3866 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5423 -4.2427 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
8 11 2 0
7 12 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
9 20 2 0
10 21 1 0
21 22 1 0
12 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 1 0
29 31 1 0
29 32 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.1821AlogP: 3.66#Rotatable Bonds: 5Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.06CX LogP: 3.83CX LogD: 3.09Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -1.28
References 1. Ma Z, Gao G, Fang K, Sun H.. (2019) Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d ]pyrimidine-2,4-dione., 10 (2): [PMID:30783502 ] [10.1021/acsmedchemlett.8b00531 ]