6-benzyl-1-ethyl-3-(4-(trifluoromethyl)benzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione

ID: ALA4531940

PubChem CID: 141753915

Max Phase: Preclinical

Molecular Formula: C24H24F3N3O2

Molecular Weight: 443.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c2c(c(=O)n(Cc3ccc(C(F)(F)F)cc3)c1=O)CN(Cc1ccccc1)CC2

Standard InChI:  InChI=1S/C24H24F3N3O2/c1-2-29-21-12-13-28(14-17-6-4-3-5-7-17)16-20(21)22(31)30(23(29)32)15-18-8-10-19(11-9-18)24(25,26)27/h3-11H,2,12-16H2,1H3

Standard InChI Key:  PCRPLOYFDONKHP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.3860   -3.2935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3860   -4.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0913   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0913   -2.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7966   -3.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7931   -4.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2087   -3.2995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5021   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2052   -4.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4957   -4.5206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5045   -2.0685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9185   -2.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6771   -2.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9706   -3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2623   -2.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5563   -3.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5582   -4.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2721   -4.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9752   -4.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9108   -4.5290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4914   -5.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7815   -5.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6241   -3.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6176   -4.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3224   -4.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0332   -4.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0349   -3.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3296   -2.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7428   -4.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3853   -4.9174    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8758   -5.3866    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.5423   -4.2427    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
  8 11  2  0
  7 12  1  0
  1 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 20  2  0
 10 21  1  0
 21 22  1  0
 12 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4531940

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.1821AlogP: 3.66#Rotatable Bonds: 5
Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.06CX LogP: 3.83CX LogD: 3.09
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -1.28

References

1. Ma Z, Gao G, Fang K, Sun H..  (2019)  Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.,  10  (2): [PMID:30783502] [10.1021/acsmedchemlett.8b00531]

Source