9-(6-fluoropyridin-3-yl)-2-(methoxymethyl)-5-methyl-2H-spiro[benzo[c]pyrazolo[4,3-e]azepine-6,1'-cyclopropan]-4(5H)-one

ID: ALA4532011

PubChem CID: 142469564

Max Phase: Preclinical

Molecular Formula: C21H19FN4O2

Molecular Weight: 378.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCn1cc2c(n1)C(=O)N(C)C1(CC1)c1ccc(-c3ccc(F)nc3)cc1-2

Standard InChI:  InChI=1S/C21H19FN4O2/c1-25-20(27)19-16(11-26(24-19)12-28-2)15-9-13(14-4-6-18(22)23-10-14)3-5-17(15)21(25)7-8-21/h3-6,9-11H,7-8,12H2,1-2H3

Standard InChI Key:  ZUMVAQQTFYFCPI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   33.0715   -9.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7814   -9.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7803   -8.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7246  -10.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7234  -10.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4315  -11.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4297   -9.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1376  -10.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1383  -10.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5896   -9.6903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9469  -10.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0173  -11.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3096  -10.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6021  -11.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6010  -12.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3134  -12.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0180  -12.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0976   -9.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7640  -10.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5933  -11.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7862  -11.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7167  -12.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4808  -12.5153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0224  -11.8879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6672  -13.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4495  -13.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6360  -14.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8935  -12.4846    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  8  2  0
  9  7  2  0
  7  4  1  0
  8  9  1  0
  9  2  1  0
  8 21  1  0
  2 10  1  0
 10 11  1  0
 20 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  5 12  1  0
 10 18  1  0
 11 19  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 20  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 15 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532011

    ---

Associated Targets(Human)

GRM3 Tchem Metabotropic glutamate receptor 3 (732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.41Molecular Weight (Monoisotopic): 378.1492AlogP: 3.43#Rotatable Bonds: 3
Polar Surface Area: 60.25Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.07CX LogP: 2.90CX LogD: 2.90
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -0.34

References

1. Kargbo RB..  (2019)  Allosteric mGluR3 Modulators for the Treatment of Psychiatric Disorders.,  10  (2): [PMID:30783491] [10.1021/acsmedchemlett.8b00619]

Source