The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(2-(3-(cyclohexanecarboxamido)propyl)hydrazinyl)-2-(4'-methoxybiphenyl-4-yl)-3H-imidazo[4,5-b]pyridine-6-carboxamide ID: ALA4532014
PubChem CID: 155546383
Max Phase: Preclinical
Molecular Formula: C30H35N7O3
Molecular Weight: 541.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(-c3nc4c(NNCCCNC(=O)C5CCCCC5)c(C(N)=O)cnc4[nH]3)cc2)cc1
Standard InChI: InChI=1S/C30H35N7O3/c1-40-23-14-12-20(13-15-23)19-8-10-21(11-9-19)28-35-26-25(24(27(31)38)18-33-29(26)36-28)37-34-17-5-16-32-30(39)22-6-3-2-4-7-22/h8-15,18,22,34H,2-7,16-17H2,1H3,(H2,31,38)(H,32,39)(H2,33,35,36,37)
Standard InChI Key: UPTOVWHBPYWOJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.0986 -11.5356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9158 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3221 -10.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9158 -10.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6878 -10.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0953 -10.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5458 -9.5146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7986 -9.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8864 -10.6637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0923 -9.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0914 -8.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3834 -8.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6758 -8.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6807 -9.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3892 -9.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9670 -8.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9651 -7.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2565 -7.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5495 -7.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5555 -8.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2646 -8.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3262 -9.4168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1434 -9.4189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5538 -8.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3710 -8.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7813 -8.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5985 -8.0097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0089 -7.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8261 -7.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6021 -6.5943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1393 -10.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5470 -11.5412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5489 -10.1258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8396 -7.0111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8352 -6.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2266 -8.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0402 -8.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4544 -7.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0489 -6.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2291 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
13 16 1 0
4 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
3 31 1 0
31 32 2 0
31 33 1 0
19 34 1 0
34 35 1 0
29 36 1 0
29 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.66Molecular Weight (Monoisotopic): 541.2801AlogP: 4.40#Rotatable Bonds: 11Polar Surface Area: 147.05Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.59CX Basic pKa: 5.44CX LogP: 4.23CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.14Np Likeness Score: -0.89
References 1. Sintim HO, Mikek CG, Wang M, Sooreshjani MA.. (2019) Interrupting cyclic dinucleotide-cGAS-STING axis with small molecules., 10 (12): [PMID:32206239 ] [10.1039/C8MD00555A ]