The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3-((4-((3-(2,6-dichlorophenyl)-5-isopropylisoxazol-4-yl)methoxy)benzyl)oxy)benzoate ID: ALA4532035
PubChem CID: 155546534
Max Phase: Preclinical
Molecular Formula: C28H25Cl2NO5
Molecular Weight: 526.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cccc(OCc2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C(C)C)cc2)c1
Standard InChI: InChI=1S/C28H25Cl2NO5/c1-17(2)27-22(26(31-36-27)25-23(29)8-5-9-24(25)30)16-35-20-12-10-18(11-13-20)15-34-21-7-4-6-19(14-21)28(32)33-3/h4-14,17H,15-16H2,1-3H3
Standard InChI Key: CCCRNOJXBNWALH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
27.1310 -5.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1298 -5.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8379 -6.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5475 -5.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5447 -5.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8361 -4.6552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2509 -4.6492 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.4232 -4.6556 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.8337 -3.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4875 -3.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2326 -2.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4154 -2.5808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1653 -3.3587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7110 -1.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5240 -1.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3764 -1.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2661 -3.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8703 -3.0528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6489 -3.3010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8200 -4.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5977 -4.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2029 -3.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0251 -2.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2476 -2.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9818 -4.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5853 -3.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3643 -3.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5355 -4.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3136 -4.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9180 -4.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7391 -3.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9613 -3.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3407 -2.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1205 -3.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1624 -2.0789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7220 -2.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
1 8 1 0
6 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 9 2 0
11 14 1 0
14 15 1 0
14 16 1 0
10 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.42Molecular Weight (Monoisotopic): 525.1110AlogP: 7.72#Rotatable Bonds: 9Polar Surface Area: 70.79Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.80CX LogD: 7.80Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -0.88
References 1. Sepe V, Marchianò S, Finamore C, Baronissi G, Di Leva FS, Carino A, Biagioli M, Fiorucci C, Cassiano C, Monti MC, Del Gaudio F, Novellino E, Limongelli V, Fiorucci S, Zampella A.. (2019) Novel Isoxazole Derivatives with Potent FXR Agonistic Activity Prevent Acetaminophen-Induced Liver Injury., 10 (4): [PMID:30996771 ] [10.1021/acsmedchemlett.8b00423 ]