5-(pentafluoro-lambda6-sulfanyl)-3-(1H-pyrrol-2-ylmethylene)indolin-2-one

ID: ALA4532052

PubChem CID: 155546293

Max Phase: Preclinical

Molecular Formula: C13H9F5N2OS

Molecular Weight: 336.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccc(S(F)(F)(F)(F)F)cc2/C1=C/c1ccc[nH]1

Standard InChI:  InChI=1S/C13H9F5N2OS/c14-22(15,16,17,18)9-3-4-12-10(7-9)11(13(21)20-12)6-8-2-1-5-19-8/h1-7,19H,(H,20,21)/b11-6-

Standard InChI Key:  IYKAGZMYQUXUQT-WDZFZDKYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   27.9952  -21.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9940  -22.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7087  -22.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7069  -21.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4222  -21.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4270  -22.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2144  -22.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6963  -21.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2066  -21.2213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5212  -21.8820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4739  -23.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2818  -23.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6233  -24.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4432  -24.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6100  -23.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8932  -22.9492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2791  -22.7240    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.2785  -23.5490    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.5647  -22.3115    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.5647  -23.1365    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.2791  -21.8990    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.9936  -23.1365    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  7 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
  2 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
 17 21  1  0
 17 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532052

    ---

Associated Targets(Human)

T47D (39041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.29Molecular Weight (Monoisotopic): 336.0356AlogP: 5.16#Rotatable Bonds: 2
Polar Surface Area: 44.89Molecular Species: NEUTRALHBA: 1HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.72CX Basic pKa: CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.58Np Likeness Score: -0.38

References

1. Meanwell NA..  (2018)  Fluorine and Fluorinated Motifs in the Design and Application of Bioisosteres for Drug Design.,  61  (14): [PMID:29400967] [10.1021/acs.jmedchem.7b01788]

Source