(E)-N-(5-(3-(4-methoxyphenyl)acryloyl)-4-methylthiazol-2-yl)benzamide

ID: ALA4532066

PubChem CID: 155546357

Max Phase: Preclinical

Molecular Formula: C21H18N2O3S

Molecular Weight: 378.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/C(=O)c2sc(NC(=O)c3ccccc3)nc2C)cc1

Standard InChI:  InChI=1S/C21H18N2O3S/c1-14-19(18(24)13-10-15-8-11-17(26-2)12-9-15)27-21(22-14)23-20(25)16-6-4-3-5-7-16/h3-13H,1-2H3,(H,22,23,25)/b13-10+

Standard InChI Key:  DGVLCNJYSJDEAV-JLHYYAGUSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   32.0974  -13.0297    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.4304  -13.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6847  -14.2926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5060  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7604  -13.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9861  -14.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4636  -13.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1756  -13.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4548  -12.2786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8789  -13.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5910  -13.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7190  -13.0998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0107  -13.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3035  -13.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0097  -14.3247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3076  -12.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6012  -11.8727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8920  -12.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8936  -13.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6005  -13.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5951  -14.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3063  -14.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0106  -14.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9991  -13.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2874  -13.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7231  -14.6825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7330  -15.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  1  2  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  4  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 14  1  0
 11 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 11  1  0
 23 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532066

    ---

Associated Targets(Human)

ALOX5 Tclin Arachidonate 5-lipoxygenase (6568 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.45Molecular Weight (Monoisotopic): 378.1038AlogP: 4.61#Rotatable Bonds: 6
Polar Surface Area: 68.29Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.75CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.50Np Likeness Score: -1.24

References

1. Sinha S, Manju SL, Doble M..  (2019)  Chalcone-Thiazole Hybrids: Rational Design, Synthesis, and Lead Identification against 5-Lipoxygenase.,  10  (10): [PMID:31620227] [10.1021/acsmedchemlett.9b00193]

Source