Methyl (4aR,10aS)-9-(Butylthio)-5,6-dihydroxy-7-isopropyl-1,1-dimethyl-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2H)-carboxylate

ID: ALA4532131

PubChem CID: 155546327

Max Phase: Preclinical

Molecular Formula: C25H38O4S

Molecular Weight: 434.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCSC1C[C@H]2C(C)(C)CCC[C@]2(C(=O)OC)c2c1cc(C(C)C)c(O)c2O

Standard InChI:  InChI=1S/C25H38O4S/c1-7-8-12-30-18-14-19-24(4,5)10-9-11-25(19,23(28)29-6)20-17(18)13-16(15(2)3)21(26)22(20)27/h13,15,18-19,26-27H,7-12,14H2,1-6H3/t18?,19-,25+/m0/s1

Standard InChI Key:  ZGXATVQQSWVMBR-HXTXIVFLSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    4.4314   -3.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0238   -4.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2318   -4.1249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0197   -3.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2359   -5.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9436   -4.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9444   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7323   -3.1139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6523   -3.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6523   -2.6744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3604   -3.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0685   -3.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7765   -3.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0685   -2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3633   -4.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6514   -5.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6514   -5.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3636   -6.3557    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.0717   -5.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7841   -6.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4882   -5.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1996   -6.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9436   -6.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2359   -5.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4480   -6.7359    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5281   -6.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9347   -7.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1153   -7.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8163   -5.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8163   -5.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5281   -4.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  5  2  1  1
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  7  2  0
  9 10  1  0
 11  9  1  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 15 11  2  0
 16 15  1  0
 16  6  2  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 17  1  0
 24 23  1  0
 24 25  1  6
 26 24  1  0
 26 27  1  0
 26 28  1  0
 29 26  1  0
 30 29  1  0
 30 31  1  0
  5 31  1  0
 24  5  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532131

    ---

Associated Targets(Human)

FDPS Tclin Farnesyl diphosphate synthase (1240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GGPS1 Tchem Geranylgeranyl pyrophosphate synthetase (715 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.64Molecular Weight (Monoisotopic): 434.2491AlogP: 6.44#Rotatable Bonds: 6
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.24CX Basic pKa: CX LogP: 6.81CX LogD: 6.81
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: 1.56

References

1. Han S, Li X, Xia Y, Yu Z, Cai N, Malwal SR, Han X, Oldfield E, Zhang Y..  (2019)  Farnesyl Pyrophosphate Synthase as a Target for Drug Development: Discovery of Natural-Product-Derived Inhibitors and Their Activity in Pancreatic Cancer Cells.,  62  (23): [PMID:31725297] [10.1021/acs.jmedchem.9b01405]

Source