(S)-7-ethoxy-6-methoxy-1-(2-(6-methyl-1H-indol-3-yl)ethyl)-3,4-dihydroisoquinoline-2(1H)-carbaldehyde

ID: ALA4532140

PubChem CID: 139399269

Max Phase: Preclinical

Molecular Formula: C24H28N2O3

Molecular Weight: 392.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cc2c(cc1OC)CCN(C=O)[C@H]2CCc1c[nH]c2cc(C)ccc12

Standard InChI:  InChI=1S/C24H28N2O3/c1-4-29-24-13-20-17(12-23(24)28-3)9-10-26(15-27)22(20)8-6-18-14-25-21-11-16(2)5-7-19(18)21/h5,7,11-15,22,25H,4,6,8-10H2,1-3H3/t22-/m0/s1

Standard InChI Key:  ZJZPPYKGEHXILI-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   36.0994  -22.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0983  -23.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8064  -23.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8046  -21.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5132  -22.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5120  -23.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2182  -23.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9301  -23.1473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9313  -22.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2205  -21.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6367  -23.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3455  -23.1513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2159  -24.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9225  -24.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9202  -25.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2596  -26.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5100  -26.8574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.5818  -26.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3263  -26.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8690  -27.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6672  -27.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9199  -26.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3755  -25.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3916  -21.9198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3914  -21.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3903  -23.5558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6829  -23.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2131  -27.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9749  -23.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  2  0
  7 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 19  1  0
 18 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  1  0
 21 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532140

    ---

Associated Targets(Human)

PDE4D Tclin Phosphodiesterase 4D (3546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDE4A Tclin Phosphodiesterase 4 (3344 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.50Molecular Weight (Monoisotopic): 392.2100AlogP: 4.57#Rotatable Bonds: 7
Polar Surface Area: 54.56Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: 0.16

References

1. Zhang X, Dong G, Li H, Chen W, Li J, Feng C, Gu Z, Zhu F, Zhang R, Li M, Tang W, Liu H, Xu Y..  (2019)  Structure-Aided Identification and Optimization of Tetrahydro-isoquinolines as Novel PDE4 Inhibitors Leading to Discovery of an Effective Antipsoriasis Agent.,  62  (11): [PMID:31099559] [10.1021/acs.jmedchem.9b00518]

Source