(S)-4-(2-(2-Hydroxy-3-(isopropylamino)propoxy)phenyl)-N-(2-(4-(2-methoxyphenyl)butanamido)ethyl)butanamide

ID: ALA4532142

PubChem CID: 155546387

Max Phase: Preclinical

Molecular Formula: C29H43N3O5

Molecular Weight: 513.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1CCCC(=O)NCCNC(=O)CCCc1ccccc1OC[C@@H](O)CNC(C)C

Standard InChI:  InChI=1S/C29H43N3O5/c1-22(2)32-20-25(33)21-37-27-15-7-5-11-24(27)13-9-17-29(35)31-19-18-30-28(34)16-8-12-23-10-4-6-14-26(23)36-3/h4-7,10-11,14-15,22,25,32-33H,8-9,12-13,16-21H2,1-3H3,(H,30,34)(H,31,35)/t25-/m0/s1

Standard InChI Key:  AWAWTXAIDXZJMM-VWLOTQADSA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   23.5244  -15.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2341  -15.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9499  -15.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9539  -14.3173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2362  -13.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5234  -14.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8091  -13.9002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8094  -13.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8109  -15.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8098  -16.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5245  -16.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2410  -16.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2381  -15.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5227  -15.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5203  -14.3453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2335  -13.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2310  -13.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9442  -12.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5153  -12.6954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9510  -15.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9418  -11.8661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6550  -11.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6525  -10.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3707  -11.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6670  -15.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3799  -15.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0960  -15.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8088  -15.1535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5249  -15.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2377  -15.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9538  -15.5579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0990  -16.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6666  -15.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3827  -15.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6636  -14.3177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0955  -15.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8116  -15.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  1
 13 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 27 32  2  0
 31 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 36 37  1  0
 37  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532142

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.68Molecular Weight (Monoisotopic): 513.3203AlogP: 3.01#Rotatable Bonds: 18
Polar Surface Area: 108.92Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.67CX LogP: 3.13CX LogD: 0.90
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -0.41

References

1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D..  (2019)  Probing the Existence of a Metastable Binding Site at the β2-Adrenergic Receptor with Homobivalent Bitopic Ligands.,  62  (17): [PMID:31298548] [10.1021/acs.jmedchem.9b00595]

Source