The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((4,6-Dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-1-isopropyl-6-(6-(4-isopropylpiperazin-1-yl)pyridin-3-yl)-1H-indazole-4-carboxamide ID: ALA4532174
PubChem CID: 139211326
Max Phase: Preclinical
Molecular Formula: C31H39N7O2
Molecular Weight: 541.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(CNC(=O)c2cc(-c3ccc(N4CCN(C(C)C)CC4)nc3)cc3c2cnn3C(C)C)c(=O)[nH]1
Standard InChI: InChI=1S/C31H39N7O2/c1-19(2)36-9-11-37(12-10-36)29-8-7-23(16-32-29)24-14-25(27-18-34-38(20(3)4)28(27)15-24)30(39)33-17-26-21(5)13-22(6)35-31(26)40/h7-8,13-16,18-20H,9-12,17H2,1-6H3,(H,33,39)(H,35,40)
Standard InChI Key: XHJAGCFBPKQPDU-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
12.0482 -7.5887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5430 -6.9383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0819 -6.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3003 -6.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6016 -6.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8827 -6.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8625 -7.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5612 -7.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2801 -7.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6177 -5.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9190 -4.8319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3366 -4.8647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1275 -8.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1477 -7.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4490 -7.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7342 -7.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7140 -8.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4127 -8.8876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9951 -8.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2964 -8.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5816 -8.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5614 -9.6388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2601 -10.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9790 -9.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8466 -10.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8264 -10.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1479 -9.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2840 -8.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6940 -8.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0802 -8.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3527 -4.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0919 -2.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0717 -3.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7703 -4.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4851 -3.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5054 -2.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8067 -2.4470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3932 -2.4141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2201 -2.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7501 -4.8975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
5 10 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
19 24 1 0
25 26 1 0
25 27 1 0
22 25 1 0
17 19 1 0
7 14 1 0
28 29 1 0
28 30 1 0
1 28 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 1 0
32 38 2 0
36 39 1 0
34 40 1 0
31 33 1 0
12 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.70Molecular Weight (Monoisotopic): 541.3165AlogP: 4.44#Rotatable Bonds: 7Polar Surface Area: 99.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.64CX Basic pKa: 8.06CX LogP: 3.12CX LogD: 2.37Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -1.77
References 1. Yang X, Li F, Konze KD, Meslamani J, Ma A, Brown PJ, Zhou MM, Arrowsmith CH, Kaniskan HÜ, Vedadi M, Jin J.. (2016) Structure-Activity Relationship Studies for Enhancer of Zeste Homologue 2 (EZH2) and Enhancer of Zeste Homologue 1 (EZH1) Inhibitors., 59 (16): [PMID:27468126 ] [10.1021/acs.jmedchem.6b00855 ] 2. Lu D, Wang C, Qu L, Yin F, Li S, Luo H, Zhang Y, Liu X, Chen X, Luo Z, Cui N, Kong L, Wang X.. (2022) Histone Deacetylase and Enhancer of Zeste Homologue 2 Dual Inhibitors Presenting a Synergistic Effect for the Treatment of Hematological Malignancies., 65 (19.0): [PMID:36153841 ] [10.1021/acs.jmedchem.2c00673 ] 3. Tomaselli D, Mautone N, Mai A, Rotili D.. (2020) Recent advances in epigenetic proteolysis targeting chimeras (Epi-PROTACs)., 207 [PMID:32871345 ] [10.1016/j.ejmech.2020.112750 ] 4. Sun D, Zhang J, Dong G, He S, Sheng C.. (2022) Blocking Non-enzymatic Functions by PROTAC-Mediated Targeted Protein Degradation., 65 (21.0): [PMID:36306471 ] [10.1021/acs.jmedchem.2c01159 ]