The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Hydroxy-4-oxo-1,3-diphenyl-2-thioxo-N-(3-(trifluoromethoxy)phenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxamide ID: ALA4532318
PubChem CID: 155546705
Max Phase: Preclinical
Molecular Formula: C24H16F3N3O4S
Molecular Weight: 499.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(OC(F)(F)F)c1)c1c(O)n(-c2ccccc2)c(=S)n(-c2ccccc2)c1=O
Standard InChI: InChI=1S/C24H16F3N3O4S/c25-24(26,27)34-18-13-7-8-15(14-18)28-20(31)19-21(32)29(16-9-3-1-4-10-16)23(35)30(22(19)33)17-11-5-2-6-12-17/h1-14,32H,(H,28,31)
Standard InChI Key: ODQKMZJIXFYZII-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
32.0521 -24.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3422 -23.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6323 -23.9668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3422 -25.1967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0521 -23.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6323 -24.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7619 -23.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4718 -23.9751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9142 -25.1967 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.3422 -22.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7619 -25.1967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7661 -22.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1817 -23.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8916 -23.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1817 -22.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8916 -22.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6015 -23.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6015 -22.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9202 -23.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9244 -22.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2132 -22.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5006 -22.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5037 -23.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2155 -23.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3415 -26.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6280 -26.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6277 -27.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3401 -27.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0542 -27.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0511 -26.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3136 -23.9788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0251 -23.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7372 -23.9779 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.0247 -22.7443 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.7311 -23.1496 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 5 2 0
3 2 1 0
4 1 1 0
5 1 1 0
6 4 1 0
7 5 1 0
8 7 1 0
9 6 2 0
10 2 1 0
11 1 2 0
12 7 2 0
13 8 1 0
14 13 2 0
15 13 1 0
16 15 2 0
17 14 1 0
18 16 1 0
3 6 1 0
17 18 2 0
3 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
4 25 1 0
17 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.47Molecular Weight (Monoisotopic): 499.0814AlogP: 5.21#Rotatable Bonds: 5Polar Surface Area: 85.49Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.48CX Basic pKa: ┄CX LogP: 6.39CX LogD: 3.56Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.25
References 1. Arencibia JM, Brindani N, Franco-Ulloa S, Nigro M, Kuriappan JA, Ottonello G, Bertozzi SM, Summa M, Girotto S, Bertorelli R, Armirotti A, De Vivo M.. (2020) Design, Synthesis, Dynamic Docking, Biochemical Characterization, and in Vivo Pharmacokinetics Studies of Novel Topoisomerase II Poisons with Promising Antiproliferative Activity., 63 (7): [PMID:32196342 ] [10.1021/acs.jmedchem.9b01760 ]