6-Hydroxy-4-oxo-1,3-diphenyl-2-thioxo-N-(3-(trifluoromethoxy)phenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxamide

ID: ALA4532318

PubChem CID: 155546705

Max Phase: Preclinical

Molecular Formula: C24H16F3N3O4S

Molecular Weight: 499.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(OC(F)(F)F)c1)c1c(O)n(-c2ccccc2)c(=S)n(-c2ccccc2)c1=O

Standard InChI:  InChI=1S/C24H16F3N3O4S/c25-24(26,27)34-18-13-7-8-15(14-18)28-20(31)19-21(32)29(16-9-3-1-4-10-16)23(35)30(22(19)33)17-11-5-2-6-12-17/h1-14,32H,(H,28,31)

Standard InChI Key:  ODQKMZJIXFYZII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   32.0521  -24.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3422  -23.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6323  -23.9668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3422  -25.1967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0521  -23.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6323  -24.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7619  -23.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4718  -23.9751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9142  -25.1967    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.3422  -22.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7619  -25.1967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7661  -22.7328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1817  -23.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8916  -23.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1817  -22.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8916  -22.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6015  -23.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6015  -22.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9202  -23.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9244  -22.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2132  -22.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5006  -22.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5037  -23.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2155  -23.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3415  -26.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6280  -26.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6277  -27.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3401  -27.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0542  -27.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0511  -26.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3136  -23.9788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0251  -23.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7372  -23.9779    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0247  -22.7443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.7311  -23.1496    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  2  0
  3  2  1  0
  4  1  1  0
  5  1  1  0
  6  4  1  0
  7  5  1  0
  8  7  1  0
  9  6  2  0
 10  2  1  0
 11  1  2  0
 12  7  2  0
 13  8  1  0
 14 13  2  0
 15 13  1  0
 16 15  2  0
 17 14  1  0
 18 16  1  0
  3  6  1  0
 17 18  2  0
  3 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  4 25  1  0
 17 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532318

    ---

Associated Targets(Human)

DU-145 (51482 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TOP2A Tclin DNA topoisomerase II alpha (6317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.47Molecular Weight (Monoisotopic): 499.0814AlogP: 5.21#Rotatable Bonds: 5
Polar Surface Area: 85.49Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.48CX Basic pKa: CX LogP: 6.39CX LogD: 3.56
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.25

References

1. Arencibia JM, Brindani N, Franco-Ulloa S, Nigro M, Kuriappan JA, Ottonello G, Bertozzi SM, Summa M, Girotto S, Bertorelli R, Armirotti A, De Vivo M..  (2020)  Design, Synthesis, Dynamic Docking, Biochemical Characterization, and in Vivo Pharmacokinetics Studies of Novel Topoisomerase II Poisons with Promising Antiproliferative Activity.,  63  (7): [PMID:32196342] [10.1021/acs.jmedchem.9b01760]

Source