1-(4-methoxyphenethyl)-4-phenethylpiperazine dihydrochloride

ID: ALA4532351

PubChem CID: 155546919

Max Phase: Preclinical

Molecular Formula: C21H30Cl2N2O

Molecular Weight: 324.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CCN2CCN(CCc3ccccc3)CC2)cc1.Cl.Cl

Standard InChI:  InChI=1S/C21H28N2O.2ClH/c1-24-21-9-7-20(8-10-21)12-14-23-17-15-22(16-18-23)13-11-19-5-3-2-4-6-19;;/h2-10H,11-18H2,1H3;2*1H

Standard InChI Key:  ZTDCYMXDGBFPFD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 26  0  0  0  0  0  0  0  0999 V2000
   12.7810   -7.0157    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.2311   -8.5537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8225   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0012   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5926   -8.5537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0012   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8225   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7754   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3668   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5496   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1410   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3238   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9152   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3238   -7.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1410   -7.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0483   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4569   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2741   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6827   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4999   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9085   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4999   -9.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6827   -9.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7257   -9.2628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1343   -9.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4612   -6.8420    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  2  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  5  8  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 21 24  1  0
  2 16  1  0
M  END

Associated Targets(non-human)

Slc18a2 Synaptic vesicular amine transporter (631 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.47Molecular Weight (Monoisotopic): 324.2202AlogP: 3.10#Rotatable Bonds: 7
Polar Surface Area: 15.71Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.30CX LogP: 3.91CX LogD: 2.96
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: -0.61

References

1. Nickell JR, Culver JP, Janganati V, Zheng G, Dwoskin LP, Crooks PA..  (2016)  Synthesis and in vitro evaluation of water-soluble 1,4-diphenethylpiperazine analogs as novel inhibitors of the vesicular monoamine transporter-2.,  26  (18): [PMID:27524311] [10.1016/j.bmcl.2016.08.001]

Source