The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Cyclopentyl-2-(oxetan-3-ylmethyl)-4-(1-((1-(4-(pyridin-4-ylsulfonyl)phenyl)azetidin-3-yl)methyl)piperidin-4-yl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4532417
PubChem CID: 132104738
Max Phase: Preclinical
Molecular Formula: C38H48N4O3S
Molecular Weight: 640.89
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccncc1)c1ccc(N2CC(CN3CCC(C4(C5CCCC5)CN(CC5COC5)Cc5ccccc54)CC3)C2)cc1
Standard InChI: InChI=1S/C38H48N4O3S/c43-46(44,36-13-17-39-18-14-36)35-11-9-34(10-12-35)42-23-29(24-42)21-40-19-15-33(16-20-40)38(32-6-2-3-7-32)28-41(22-30-26-45-27-30)25-31-5-1-4-8-37(31)38/h1,4-5,8-14,17-18,29-30,32-33H,2-3,6-7,15-16,19-28H2
Standard InChI Key: AUGOJKCHJPNYFD-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 53 0 0 0 0 0 0 0 0999 V2000
29.8893 -15.8780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4768 -15.2947 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6779 -15.0776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6791 -19.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6780 -20.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3927 -20.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1091 -20.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3909 -19.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1053 -19.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8133 -19.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8131 -18.2441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0987 -17.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3845 -18.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9638 -17.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2991 -16.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6765 -16.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9565 -16.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1342 -17.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5805 -18.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9982 -17.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1973 -18.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9721 -18.8694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5545 -19.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3619 -19.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1730 -19.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5962 -18.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6087 -17.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7838 -17.6526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7746 -18.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2071 -17.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4331 -16.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8571 -15.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0570 -15.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8360 -16.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4136 -17.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7007 -14.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4988 -14.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7229 -13.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1475 -12.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3451 -13.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1247 -13.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5268 -17.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2419 -18.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4527 -19.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2492 -18.8227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0344 -18.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 4 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
13 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 2 1 0
2 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
11 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.89Molecular Weight (Monoisotopic): 640.3447AlogP: 5.65#Rotatable Bonds: 9Polar Surface Area: 65.98Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.90CX LogP: 5.19CX LogD: 2.23Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.30Np Likeness Score: -0.58
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]