The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-3-(2-(4-(4-(4-Fluorophenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2(1H)-yl)piperidin-1-yl)-2-oxoethyl)-3-azaspiro[5.5]undecane-2,4-dione ID: ALA4532495
PubChem CID: 155546738
Max Phase: Preclinical
Molecular Formula: C31H37FN4O4
Molecular Weight: 548.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN1C(=O)CC2(CCCCC2)CC1=O)N1CCC(N2N=C(c3ccc(F)cc3)[C@H]3CC=CC[C@H]3C2=O)CC1
Standard InChI: InChI=1S/C31H37FN4O4/c32-22-10-8-21(9-11-22)29-24-6-2-3-7-25(24)30(40)36(33-29)23-12-16-34(17-13-23)28(39)20-35-26(37)18-31(19-27(35)38)14-4-1-5-15-31/h2-3,8-11,23-25H,1,4-7,12-20H2/t24-,25+/m0/s1
Standard InChI Key: UWZCOZIAVQTCPF-LOSJGSFVSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
22.2788 -8.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2747 -9.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9764 -9.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6868 -9.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6909 -8.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9847 -7.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7629 -5.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7617 -5.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4739 -6.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4721 -4.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1849 -5.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1856 -5.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8983 -6.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6066 -5.9129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6018 -5.0866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8927 -4.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9000 -7.1491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8878 -3.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5950 -3.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5910 -2.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8765 -2.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1686 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1761 -3.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3200 -6.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3189 -7.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0282 -7.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7409 -7.1386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7397 -6.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0258 -5.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4527 -7.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1799 -4.2758 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.1799 -6.7315 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.8700 -1.4078 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4549 -8.3643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1594 -7.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8682 -7.5434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8674 -8.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5721 -8.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2809 -7.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5717 -7.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5688 -6.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1595 -8.7666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 12 1 0
11 10 1 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 11 1 0
13 17 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 18 1 0
14 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
11 31 1 1
12 32 1 1
21 33 1 0
30 34 2 0
30 35 1 0
35 36 1 0
36 37 1 0
36 40 1 0
37 38 1 0
38 1 1 0
1 39 1 0
39 40 1 0
40 41 2 0
37 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.66Molecular Weight (Monoisotopic): 548.2799AlogP: 4.04#Rotatable Bonds: 4Polar Surface Area: 90.36Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.89CX LogP: 2.61CX LogD: 2.61Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.42Np Likeness Score: -0.79
References 1. Salado IG, Singh AK, Moreno-Cinos C, Sakaine G, Siderius M, Van der Veken P, Matheeussen A, van der Meer T, Sadek P, Gul S, Maes L, Sterk GJ, Leurs R, Brown D, Augustyns K.. (2020) Lead Optimization of Phthalazinone Phosphodiesterase Inhibitors as Novel Antitrypanosomal Compounds., 63 (7): [PMID:32196340 ] [10.1021/acs.jmedchem.9b00985 ]