The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,7S,8S)-8-Benzyl-3-((R)-s-butyl)-7-hydroxy-1,4,9-triazacyclohenicosane-2,5,10-trione ID: ALA4532529
PubChem CID: 155547688
Max Phase: Preclinical
Molecular Formula: C29H47N3O4
Molecular Weight: 501.71
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](C)[C@@H]1NC(=O)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)CCCCCCCCCCCNC1=O
Standard InChI: InChI=1S/C29H47N3O4/c1-3-22(2)28-29(36)30-19-15-10-8-6-4-5-7-9-14-18-26(34)31-24(25(33)21-27(35)32-28)20-23-16-12-11-13-17-23/h11-13,16-17,22,24-25,28,33H,3-10,14-15,18-21H2,1-2H3,(H,30,36)(H,31,34)(H,32,35)/t22-,24+,25+,28+/m1/s1
Standard InChI Key: MSYBGNDUMJDJKA-VOGKQTDESA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
5.0765 -23.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7636 -22.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4548 -23.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -22.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8289 -23.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5119 -22.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1989 -23.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1989 -23.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0765 -23.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8819 -24.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8819 -25.2256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3894 -24.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3894 -25.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7023 -25.5104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0765 -25.5104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0765 -26.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7636 -26.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4548 -26.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -26.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8289 -26.3028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -27.4915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7636 -27.4915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5119 -26.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3929 -26.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5119 -27.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3726 -26.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9614 -26.9065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3705 -27.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6627 -27.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6603 -28.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3675 -29.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0786 -28.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0775 -27.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8041 -27.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2196 -27.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2196 -28.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1927 -27.1509 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 1 0
8 10 1 0
10 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
17 22 1 6
20 23 1 0
23 24 1 0
23 25 1 0
24 11 1 0
16 26 1 6
24 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 34 1 1
25 35 1 0
35 36 1 0
23 37 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.71Molecular Weight (Monoisotopic): 501.3567AlogP: 4.03#Rotatable Bonds: 4Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.89CX Basic pKa: ┄CX LogP: 4.35CX LogD: 4.35Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: 0.85
References 1. Houštecká R, Hadzima M, Fanfrlík J, Brynda J, Pallová L, Hánová I, Mertlíková-Kaiserová H, Lepšík M, Horn M, Smrčina M, Majer P, Mareš M.. (2020) Biomimetic Macrocyclic Inhibitors of Human Cathepsin D: Structure-Activity Relationship and Binding Mode Analysis., 63 (4): [PMID:32003991 ] [10.1021/acs.jmedchem.9b01351 ]