The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(2-Hydroxy-3-methoxybenzoyl)-8-methoxy-2-oxo-2H-chromene-3-carbohydrazide ID: ALA4532531
PubChem CID: 146000018
Max Phase: Preclinical
Molecular Formula: C19H16N2O7
Molecular Weight: 384.34
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C(=O)NNC(=O)c2cc3cccc(OC)c3oc2=O)c1O
Standard InChI: InChI=1S/C19H16N2O7/c1-26-13-7-4-6-11(15(13)22)17(23)20-21-18(24)12-9-10-5-3-8-14(27-2)16(10)28-19(12)25/h3-9,22H,1-2H3,(H,20,23)(H,21,24)
Standard InChI Key: JVHWWVLJUZGYJN-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
15.1661 -13.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1650 -14.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8730 -14.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8713 -12.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5799 -13.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5787 -14.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2888 -14.4400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0046 -14.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0058 -13.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2912 -12.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7112 -14.4413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7145 -12.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4212 -13.2090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7165 -11.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1299 -12.8021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8366 -13.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5453 -12.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8346 -14.0297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2484 -13.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9567 -12.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9591 -11.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2474 -11.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5421 -11.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2443 -14.0356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6632 -13.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3721 -12.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8728 -15.2528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1649 -15.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
8 11 2 0
9 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
19 24 1 0
20 25 1 0
25 26 1 0
3 27 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 384.34Molecular Weight (Monoisotopic): 384.0958AlogP: 1.59#Rotatable Bonds: 4Polar Surface Area: 127.10Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.37CX Basic pKa: ┄CX LogP: 1.86CX LogD: 1.82Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.46Np Likeness Score: -0.51
References 1. Jesumoroti OJ, Faridoon, Mnkandhla D, Isaacs M, Hoppe HC, Klein R.. (2019) Evaluation of novel N '-(3-hydroxybenzoyl)-2-oxo-2H -chromene-3-carbohydrazide derivatives as potential HIV-1 integrase inhibitors., 10 (1): [PMID:30774857 ] [10.1039/C8MD00328A ]