N-Ethyl-N-(3-methoxybenzyl)-2-(3-(4-methoxyphenyl)-9H-carbazol-9-yl)acetamide

ID: ALA4532562

PubChem CID: 155547788

Max Phase: Preclinical

Molecular Formula: C31H30N2O3

Molecular Weight: 478.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(Cc1cccc(OC)c1)C(=O)Cn1c2ccccc2c2cc(-c3ccc(OC)cc3)ccc21

Standard InChI:  InChI=1S/C31H30N2O3/c1-4-32(20-22-8-7-9-26(18-22)36-3)31(34)21-33-29-11-6-5-10-27(29)28-19-24(14-17-30(28)33)23-12-15-25(35-2)16-13-23/h5-19H,4,20-21H2,1-3H3

Standard InChI Key:  XPMXYBXIOCDXNX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   33.8391  -24.1113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4305  -25.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1807  -24.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3856  -24.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8396  -25.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0941  -25.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8886  -25.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5021  -24.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2459  -25.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7878  -25.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5859  -25.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8393  -25.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2957  -24.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8374  -23.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5442  -22.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5424  -22.0668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2528  -23.2911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2493  -21.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8339  -21.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9579  -22.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9554  -22.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6632  -23.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3710  -22.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3666  -22.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6583  -21.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8321  -20.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0720  -21.6411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7820  -22.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1294  -26.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8733  -27.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4179  -27.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2186  -27.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4718  -26.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9256  -26.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7647  -28.2392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5642  -28.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 24 27  1  0
 27 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 29  1  0
 32 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532562

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.59Molecular Weight (Monoisotopic): 478.2256AlogP: 6.53#Rotatable Bonds: 8
Polar Surface Area: 43.70Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.85CX LogD: 5.85
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.14

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source