The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Ethyl-N-(3-methoxybenzyl)-2-(3-(4-methoxyphenyl)-9H-carbazol-9-yl)acetamide ID: ALA4532562
PubChem CID: 155547788
Max Phase: Preclinical
Molecular Formula: C31H30N2O3
Molecular Weight: 478.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(Cc1cccc(OC)c1)C(=O)Cn1c2ccccc2c2cc(-c3ccc(OC)cc3)ccc21
Standard InChI: InChI=1S/C31H30N2O3/c1-4-32(20-22-8-7-9-26(18-22)36-3)31(34)21-33-29-11-6-5-10-27(29)28-19-24(14-17-30(28)33)23-12-15-25(35-2)16-13-23/h5-19H,4,20-21H2,1-3H3
Standard InChI Key: XPMXYBXIOCDXNX-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
33.8391 -24.1113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4305 -25.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1807 -24.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3856 -24.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8396 -25.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0941 -25.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8886 -25.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5021 -24.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2459 -25.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7878 -25.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5859 -25.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8393 -25.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2957 -24.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8374 -23.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5442 -22.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5424 -22.0668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2528 -23.2911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2493 -21.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8339 -21.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9579 -22.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9554 -22.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6632 -23.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3710 -22.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3666 -22.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6583 -21.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8321 -20.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0720 -21.6411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7820 -22.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1294 -26.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8733 -27.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4179 -27.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2186 -27.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4718 -26.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9256 -26.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7647 -28.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5642 -28.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
24 27 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
11 29 1 0
32 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.59Molecular Weight (Monoisotopic): 478.2256AlogP: 6.53#Rotatable Bonds: 8Polar Surface Area: 43.70Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.85CX LogD: 5.85Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.14
References 1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M.. (2019) First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold., 62 (17): [PMID:31419132 ] [10.1021/acs.jmedchem.9b00980 ]