The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-(2-Chlorobenzoyl)piperidin-4-yl)-8,9-dihydro-2,4,7,9a-tetraazabenzo[cd]azulen-6(7H)-one ID: ALA4532640
PubChem CID: 155547387
Max Phase: Preclinical
Molecular Formula: C21H20ClN5O2
Molecular Weight: 409.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NCCn2c(C3CCN(C(=O)c4ccccc4Cl)CC3)nc3cncc1c32
Standard InChI: InChI=1S/C21H20ClN5O2/c22-16-4-2-1-3-14(16)21(29)26-8-5-13(6-9-26)19-25-17-12-23-11-15-18(17)27(19)10-7-24-20(15)28/h1-4,11-13H,5-10H2,(H,24,28)
Standard InChI Key: QWHBOKIAPQHJQG-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
8.8404 -7.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3561 -7.7262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5789 -7.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5789 -6.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8698 -6.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7789 -5.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3573 -4.8485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1704 -4.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6143 -5.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3561 -6.3997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1566 -6.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1566 -7.4716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8698 -7.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0037 -5.1556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3002 -7.0630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8916 -7.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0703 -7.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6617 -7.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0703 -6.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8916 -6.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1215 -7.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5301 -6.3539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5301 -7.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1178 -8.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5257 -9.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3449 -9.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7546 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3443 -7.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7511 -7.0616 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 10 1 0
4 10 1 0
11 12 2 0
12 13 1 0
3 13 2 0
5 11 1 0
6 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 2 0
21 23 1 0
15 21 1 0
1 18 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.88Molecular Weight (Monoisotopic): 409.1306AlogP: 2.85#Rotatable Bonds: 2Polar Surface Area: 80.12Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.14CX LogP: 1.46CX LogD: 1.46Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -1.24
References 1. Li H, Hu Y, Wang X, He G, Xu Y, Zhu Q.. (2016) Novel tricyclic poly (ADP-ribose) polymerase-1/2 inhibitors with potent anticancer chemopotentiating activity: Design, synthesis and biological evaluation., 24 (19): [PMID:27561983 ] [10.1016/j.bmc.2016.08.016 ]