The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(3-chlorophenyl)-2-hydroxyethyl)-6-(2-((1-methyl-1H-pyrazol-4-yl)amino)pyrimidin-4-yl)isoindolin-1-one ID: ALA4532652
PubChem CID: 146634741
Max Phase: Preclinical
Molecular Formula: C24H21ClN6O2
Molecular Weight: 460.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(Nc2nccc(-c3ccc4c(c3)C(=O)N(C(CO)c3cccc(Cl)c3)C4)n2)cn1
Standard InChI: InChI=1S/C24H21ClN6O2/c1-30-13-19(11-27-30)28-24-26-8-7-21(29-24)15-5-6-17-12-31(23(33)20(17)10-15)22(14-32)16-3-2-4-18(25)9-16/h2-11,13,22,32H,12,14H2,1H3,(H,26,28,29)
Standard InChI Key: BPOZAQHOAURPCX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
4.1795 -1.4816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1783 -2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8864 -2.7101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5960 -2.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5932 -1.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8846 -1.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3009 -2.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3008 -3.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0083 -3.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0044 -2.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4703 -2.7092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7125 -2.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7194 -3.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5001 -3.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9756 -3.1005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4887 -2.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7346 -1.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7927 -3.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2074 -3.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1952 -2.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0127 -2.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4151 -1.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0004 -0.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1790 -0.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7803 -1.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0246 -3.7906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4696 -3.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2323 -1.6620 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.8054 -4.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0573 -4.7823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8746 -4.7830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1276 -4.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3545 -5.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 13 2 0
12 10 2 0
10 7 1 0
4 7 1 0
2 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
15 18 1 0
18 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
11 27 1 0
22 28 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 27 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.93Molecular Weight (Monoisotopic): 460.1415AlogP: 3.96#Rotatable Bonds: 6Polar Surface Area: 96.17Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.69CX Basic pKa: 1.91CX LogP: 3.38CX LogD: 3.38Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.44
References 1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y.. (2019) Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design., 164 [PMID:30605831 ] [10.1016/j.ejmech.2018.12.040 ]