The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
octadecyl 4-(4-(bis(2-chloroethyl)amino)phenyl)butanoate ID: ALA4532674
PubChem CID: 54597971
Max Phase: Preclinical
Molecular Formula: C32H55Cl2NO2
Molecular Weight: 556.70
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCCCOC(=O)CCCc1ccc(N(CCCl)CCCl)cc1
Standard InChI: InChI=1S/C32H55Cl2NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-29-37-32(36)20-18-19-30-21-23-31(24-22-30)35(27-25-33)28-26-34/h21-24H,2-20,25-29H2,1H3
Standard InChI Key: RYRLUKXHQCAGOM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
20.3615 -12.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6506 -11.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9354 -12.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2243 -11.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5134 -12.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7982 -11.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0871 -12.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3762 -11.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6651 -12.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9542 -11.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2431 -12.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5322 -11.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8211 -12.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1101 -11.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3991 -12.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -14.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9717 -11.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5539 -12.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -13.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1228 -12.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2696 -11.9209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -13.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6874 -13.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1091 -13.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8384 -11.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4071 -11.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9717 -13.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5539 -13.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -12.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -15.6445 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5405 -13.5749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5405 -14.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6874 -12.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3934 -13.1635 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.9771 -12.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6880 -11.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0799 -11.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 27 1 0
24 34 1 0
19 24 1 0
33 26 1 0
31 19 1 0
18 21 1 0
22 31 1 0
17 33 2 0
17 29 1 0
29 22 2 0
27 23 2 0
20 25 1 0
32 16 1 0
31 32 1 0
23 33 1 0
16 30 1 0
25 18 1 0
26 20 1 0
18 28 2 0
21 35 1 0
35 36 1 0
36 15 1 0
15 14 1 0
14 13 1 0
13 12 1 0
12 11 1 0
11 10 1 0
10 9 1 0
9 8 1 0
8 7 1 0
7 6 1 0
6 5 1 0
5 4 1 0
4 3 1 0
3 2 1 0
2 1 1 0
1 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.70Molecular Weight (Monoisotopic): 555.3610AlogP: 10.10#Rotatable Bonds: 26Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.72CX LogP: 11.63CX LogD: 11.63Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.06Np Likeness Score: -0.18