The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-5-((1-(4-bromophenyl)-1H-pyrrol-2-yl)methylene)-1-(4-methoxyphenyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione ID: ALA4532782
PubChem CID: 2162043
Max Phase: Preclinical
Molecular Formula: C22H16BrN3O3S
Molecular Weight: 482.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2C(=O)/C(=C/c3cccn3-c3ccc(Br)cc3)C(=O)NC2=S)cc1
Standard InChI: InChI=1S/C22H16BrN3O3S/c1-29-18-10-8-16(9-11-18)26-21(28)19(20(27)24-22(26)30)13-17-3-2-12-25(17)15-6-4-14(23)5-7-15/h2-13H,1H3,(H,24,27,30)/b19-13+
Standard InChI Key: LXRAHKBXEADANO-CPNJWEJPSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
27.9847 -5.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8098 -5.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0666 -4.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3972 -4.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7323 -4.6331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9475 -4.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7789 -3.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9950 -3.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3812 -3.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5566 -4.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3403 -4.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5962 -3.6172 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
28.1298 -6.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7891 -7.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2695 -8.2609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0909 -8.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4296 -7.4265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9468 -6.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2850 -6.0017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9683 -7.6775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5726 -8.8496 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.9303 -9.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1084 -9.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7690 -9.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2508 -10.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0757 -10.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4112 -9.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6470 -6.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9125 -11.2655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0917 -11.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
14 20 2 0
16 21 2 0
15 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
13 28 2 0
28 1 1 0
25 29 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.36Molecular Weight (Monoisotopic): 481.0096AlogP: 4.08#Rotatable Bonds: 4Polar Surface Area: 63.57Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.21CX Basic pKa: ┄CX LogP: 5.05CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -1.53
References 1. (2012) Entpd5 inhibitors,