5-Chloro-N2-(2-isoprpoxy-5-methyl-4-(2-fluoroethylpiperidin-4-yl)phenyl)-N4-[2-(propane-2-sulfonyl)phenyl]pyrimidine-2,4-diamine

ID: ALA4532807

PubChem CID: 155547358

Max Phase: Preclinical

Molecular Formula: C30H39ClFN5O3S

Molecular Weight: 604.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC(C)C)cc1C1CCN(CCF)CC1

Standard InChI:  InChI=1S/C30H39ClFN5O3S/c1-19(2)40-27-17-23(22-10-13-37(14-11-22)15-12-32)21(5)16-26(27)35-30-33-18-24(31)29(36-30)34-25-8-6-7-9-28(25)41(38,39)20(3)4/h6-9,16-20,22H,10-15H2,1-5H3,(H2,33,34,35,36)

Standard InChI Key:  BYNZLZOXQBQWOU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   31.1977  -13.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6104  -12.9471    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.7929  -12.9426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9198  -15.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9186  -16.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6267  -17.0316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3363  -16.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3335  -15.7995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6249  -15.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0447  -17.0297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7518  -16.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4568  -17.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1634  -16.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1625  -15.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4492  -15.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7455  -15.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4569  -17.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1646  -18.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1647  -19.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8723  -17.8449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4450  -14.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8674  -15.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5762  -15.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2806  -15.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2824  -14.5776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5737  -14.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8631  -14.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2120  -15.3947    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.6225  -14.5771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3289  -14.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0358  -14.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7418  -14.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7398  -13.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0259  -12.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3228  -13.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6062  -12.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8956  -11.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3110  -11.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9905  -14.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6979  -14.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4059  -14.1708    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 15 21  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 14 22  1  0
  4 28  1  0
  9 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 35  2  1  0
  2 36  1  0
 36 37  1  0
 36 38  1  0
 25 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Alternative Forms:

    ALA4532807

    ---
  2. Parent:

    ALA4532807

    ---

Associated Targets(Human)

NCI-H2228 (1030 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 604.19Molecular Weight (Monoisotopic): 603.2446AlogP: 7.04#Rotatable Bonds: 11
Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.57CX Basic pKa: 7.69CX LogP: 6.54CX LogD: 6.07
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.42

References

1. Radaram B, Pisaneschi F, Rao Y, Yang P, Piwnica-Worms D, Alauddin MM..  (2019)  Novel derivatives of anaplastic lymphoma kinase inhibitors: Synthesis, radiolabeling, and preliminary biological studies of fluoroethyl analogues of crizotinib, alectinib, and ceritinib.,  182  [PMID:31425908] [10.1016/j.ejmech.2019.111571]

Source