The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-N2-(2-isoprpoxy-5-methyl-4-(2-fluoroethylpiperidin-4-yl)phenyl)-N4-[2-(propane-2-sulfonyl)phenyl]pyrimidine-2,4-diamine ID: ALA4532807
PubChem CID: 155547358
Max Phase: Preclinical
Molecular Formula: C30H39ClFN5O3S
Molecular Weight: 604.19
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC(C)C)cc1C1CCN(CCF)CC1
Standard InChI: InChI=1S/C30H39ClFN5O3S/c1-19(2)40-27-17-23(22-10-13-37(14-11-22)15-12-32)21(5)16-26(27)35-30-33-18-24(31)29(36-30)34-25-8-6-7-9-28(25)41(38,39)20(3)4/h6-9,16-20,22H,10-15H2,1-5H3,(H2,33,34,35,36)
Standard InChI Key: BYNZLZOXQBQWOU-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
31.1977 -13.6529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6104 -12.9471 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.7929 -12.9426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9198 -15.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9186 -16.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6267 -17.0316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3363 -16.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3335 -15.7995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6249 -15.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0447 -17.0297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7518 -16.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4568 -17.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1634 -16.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1625 -15.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4492 -15.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7455 -15.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4569 -17.8451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1646 -18.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1647 -19.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8723 -17.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4450 -14.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8674 -15.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5762 -15.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2806 -15.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2824 -14.5776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5737 -14.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8631 -14.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2120 -15.3947 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.6225 -14.5771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3289 -14.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0358 -14.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7418 -14.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7398 -13.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0259 -12.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3228 -13.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6062 -12.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8956 -11.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3110 -11.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9905 -14.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6979 -14.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4059 -14.1708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
12 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
15 21 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
14 22 1 0
4 28 1 0
9 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
35 2 1 0
2 36 1 0
36 37 1 0
36 38 1 0
25 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.19Molecular Weight (Monoisotopic): 603.2446AlogP: 7.04#Rotatable Bonds: 11Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.57CX Basic pKa: 7.69CX LogP: 6.54CX LogD: 6.07Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.42
References 1. Radaram B, Pisaneschi F, Rao Y, Yang P, Piwnica-Worms D, Alauddin MM.. (2019) Novel derivatives of anaplastic lymphoma kinase inhibitors: Synthesis, radiolabeling, and preliminary biological studies of fluoroethyl analogues of crizotinib, alectinib, and ceritinib., 182 [PMID:31425908 ] [10.1016/j.ejmech.2019.111571 ]