The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{(1S,2S,4R)-2-hydroxy-4-[(6-{[(1R,2S)-2-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino}pyrimidin-4-yl)oxy]cyclopentyl}methyl sulfamate ID: ALA4532893
PubChem CID: 155547060
Max Phase: Preclinical
Molecular Formula: C21H28N4O6S
Molecular Weight: 464.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1CCc2ccccc2[C@@H]1Nc1cc(O[C@@H]2C[C@@H](COS(N)(=O)=O)[C@H](O)C2)ncn1
Standard InChI: InChI=1S/C21H28N4O6S/c1-29-18-7-6-13-4-2-3-5-16(13)21(18)25-19-10-20(24-12-23-19)31-15-8-14(17(26)9-15)11-30-32(22,27)28/h2-5,10,12,14-15,17-18,21,26H,6-9,11H2,1H3,(H2,22,27,28)(H,23,24,25)/t14-,15+,17+,18-,21-/m0/s1
Standard InChI Key: QPHSWYSKBXDWBT-WNXQOTDXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.3041 -16.5151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1271 -16.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6080 -17.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3560 -17.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0227 -18.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6894 -17.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4333 -17.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4738 -18.1365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5274 -16.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9176 -16.7769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0878 -17.5848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8721 -17.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4862 -17.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3118 -16.4813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2704 -17.5412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4407 -18.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8267 -18.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9969 -19.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7812 -19.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3952 -19.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1796 -19.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7936 -19.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6233 -18.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8391 -18.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2249 -18.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0423 -18.6446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4283 -19.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5717 -18.1365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8206 -15.8486 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.0018 -15.9339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8139 -15.0211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6123 -15.6283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
3 7 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
16 25 1 0
20 25 2 0
26 27 1 0
17 26 1 6
16 15 1 1
13 15 1 0
8 11 1 0
6 8 1 1
4 28 1 1
3 2 1 6
1 2 1 0
1 29 1 0
29 30 1 0
29 31 2 0
29 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.54Molecular Weight (Monoisotopic): 464.1730AlogP: 1.33#Rotatable Bonds: 8Polar Surface Area: 145.89Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.40CX Basic pKa: 5.55CX LogP: 1.18CX LogD: 1.17Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: 0.29
References 1. (2013) Inhibitors of nedd8-activating enzyme,