(E)-N1-(3,5-Difluorophenyl)-N3-(3-(2-(pyridin-2-yl)vinyl)-1H-indazol-6-yl)malonamide

ID: ALA4532945

PubChem CID: 141763990

Max Phase: Preclinical

Molecular Formula: C23H17F2N5O2

Molecular Weight: 433.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CC(=O)Nc1ccc2c(/C=C/c3ccccn3)n[nH]c2c1)Nc1cc(F)cc(F)c1

Standard InChI:  InChI=1S/C23H17F2N5O2/c24-14-9-15(25)11-18(10-14)28-23(32)13-22(31)27-17-4-6-19-20(29-30-21(19)12-17)7-5-16-3-1-2-8-26-16/h1-12H,13H2,(H,27,31)(H,28,32)(H,29,30)/b7-5+

Standard InChI Key:  NFEFCHHFONMKLC-FNORWQNLSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   17.5033   -5.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2130   -5.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2101   -4.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5015   -4.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7953   -5.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7920   -4.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0144   -4.3763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5371   -5.0388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0197   -5.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9163   -4.2076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6255   -4.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3317   -4.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6286   -5.4307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0409   -4.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7471   -4.1969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0440   -5.4254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4564   -4.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4566   -5.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1650   -5.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8721   -5.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8664   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1574   -4.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0136   -6.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3029   -6.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2968   -7.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5857   -8.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5793   -8.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2844   -9.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9976   -8.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0005   -8.1404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1677   -6.6432    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.5711   -4.1795    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 19 31  1  0
 21 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4532945

    ---

Associated Targets(Human)

KIT Tclin Stem cell growth factor receptor (10667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BaF3 (4657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.42Molecular Weight (Monoisotopic): 433.1350AlogP: 4.37#Rotatable Bonds: 6
Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.70CX Basic pKa: 4.59CX LogP: 3.74CX LogD: 3.73
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.53

References

1. Liu X, Wang B, Chen C, Qi Z, Zou F, Wang J, Hu C, Wang A, Ge J, Liu Q, Yu K, Hu Z, Jiang Z, Wang W, Wang L, Wang W, Ren T, Bai M, Liu Q, Liu J..  (2019)  Discovery of ( E)- N1-(3-Fluorophenyl)- N3-(3-(2-(pyridin-2-yl)vinyl)-1 H-indazol-6-yl)malonamide (CHMFL-KIT-033) as a Novel c-KIT T670I Mutant Selective Kinase Inhibitor for Gastrointestinal Stromal Tumors (GISTs).,  62  (10): [PMID:31046271] [10.1021/acs.jmedchem.9b00176]

Source