The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(1,2-dithiolan-3-yl)-N-(2-(5-methoxy-1H-indol-3-yl)ethyl)pentanamide ID: ALA4532953
PubChem CID: 11199806
Max Phase: Preclinical
Molecular Formula: C19H26N2O2S2
Molecular Weight: 378.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2[nH]cc(CCNC(=O)CCCCC3CCSS3)c2c1
Standard InChI: InChI=1S/C19H26N2O2S2/c1-23-15-6-7-18-17(12-15)14(13-21-18)8-10-20-19(22)5-3-2-4-16-9-11-24-25-16/h6-7,12-13,16,21H,2-5,8-11H2,1H3,(H,20,22)
Standard InChI Key: HYDGZQMQXIFYIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
6.6651 -21.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6640 -22.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3787 -22.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3770 -20.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0923 -21.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0972 -22.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8846 -22.4190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3666 -21.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8769 -21.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8707 -20.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5820 -19.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5760 -19.0111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2873 -18.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2812 -17.7684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0048 -19.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9505 -20.9331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9503 -20.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0109 -19.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7284 -20.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7346 -21.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4520 -21.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5469 -22.2817 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3552 -22.4473 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.7624 -21.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2058 -21.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
1 16 1 0
16 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.56Molecular Weight (Monoisotopic): 378.1436AlogP: 4.55#Rotatable Bonds: 9Polar Surface Area: 54.12Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.48CX LogD: 3.48Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.50Np Likeness Score: -0.15