5-(1,2-dithiolan-3-yl)-N-(2-(5-methoxy-1H-indol-3-yl)ethyl)pentanamide

ID: ALA4532953

PubChem CID: 11199806

Max Phase: Preclinical

Molecular Formula: C19H26N2O2S2

Molecular Weight: 378.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]cc(CCNC(=O)CCCCC3CCSS3)c2c1

Standard InChI:  InChI=1S/C19H26N2O2S2/c1-23-15-6-7-18-17(12-15)14(13-21-18)8-10-20-19(22)5-3-2-4-16-9-11-24-25-16/h6-7,12-13,16,21H,2-5,8-11H2,1H3,(H,20,22)

Standard InChI Key:  HYDGZQMQXIFYIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    6.6651  -21.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6640  -22.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3787  -22.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3770  -20.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0923  -21.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0972  -22.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8846  -22.4190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3666  -21.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8769  -21.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8707  -20.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5820  -19.8360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5760  -19.0111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2873  -18.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2812  -17.7684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0048  -19.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9505  -20.9331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9503  -20.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0109  -19.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7284  -20.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7346  -21.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4520  -21.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5469  -22.2817    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.3552  -22.4473    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7624  -21.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2058  -21.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
  1 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  1  0
M  END

Associated Targets(non-human)

Liver (4264 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.56Molecular Weight (Monoisotopic): 378.1436AlogP: 4.55#Rotatable Bonds: 9
Polar Surface Area: 54.12Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.48CX LogD: 3.48
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.50Np Likeness Score: -0.15

References

1. Wang SY, Shi XC, Laborda P..  (2020)  Indole-based melatonin analogues: Synthetic approaches and biological activity.,  185  [PMID:31727472] [10.1016/j.ejmech.2019.111847]

Source