The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-cyano-4-((4-methoxypyridin-3-yl)amino)pyridin-2-yl)-7-formyl-6-((3-oxomorpholino)methyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxamide ID: ALA4533002
PubChem CID: 132156777
Max Phase: Preclinical
Molecular Formula: C27H26N8O5
Molecular Weight: 542.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccncc1Nc1cc(NC(=O)N2CCCc3cc(CN4CCOCC4=O)c(C=O)nc32)ncc1C#N
Standard InChI: InChI=1S/C27H26N8O5/c1-39-23-4-5-29-13-21(23)31-20-10-24(30-12-19(20)11-28)33-27(38)35-6-2-3-17-9-18(22(15-36)32-26(17)35)14-34-7-8-40-16-25(34)37/h4-5,9-10,12-13,15H,2-3,6-8,14,16H2,1H3,(H2,30,31,33,38)
Standard InChI Key: XBYHUYXRZWZBOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
39.4301 -19.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4290 -19.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1370 -20.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1352 -18.7456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8439 -19.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8427 -19.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5528 -20.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2686 -19.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2698 -19.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5551 -18.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5552 -17.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2629 -17.5112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9706 -17.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8475 -17.5112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7223 -18.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7221 -17.9288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9658 -18.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6726 -19.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3814 -18.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3788 -17.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6713 -17.5123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.0838 -19.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7920 -19.5558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6722 -19.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.3797 -20.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3769 -21.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0836 -21.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7925 -21.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7903 -20.3695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.0830 -19.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6683 -21.5973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6665 -22.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7209 -20.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7203 -21.1992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0106 -21.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0080 -22.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7136 -22.8290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4234 -22.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4277 -21.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3050 -21.1903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 2 0
1 15 1 0
15 16 2 0
13 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 13 1 0
22 23 3 0
19 22 1 0
18 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
26 31 1 0
31 32 1 0
2 33 1 0
33 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
35 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.56Molecular Weight (Monoisotopic): 542.2026AlogP: 2.65#Rotatable Bonds: 7Polar Surface Area: 162.67Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.93CX Basic pKa: 6.74CX LogP: 1.35CX LogD: 1.28Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.42Np Likeness Score: -1.19
References 1. Sun C, Fang L, Zhang X, Gao P, Gou S.. (2019) Novel 7-formyl-naphthyridyl-ureas derivatives as potential selective FGFR4 inhibitors: Design, synthesis, and biological activity studies., 27 (10): [PMID:30987781 ] [10.1016/j.bmc.2019.04.018 ]