Ethyl 2-((5-Hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-en-1-yl)-6-oxo-2H,6H-pyrano[3,2-b]xanthen-9-yl)oxy)acetate

ID: ALA4533012

PubChem CID: 153535392

Max Phase: Preclinical

Molecular Formula: C28H30O8

Molecular Weight: 494.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)COc1cc2oc3cc4c(c(O)c3c(=O)c2c(CC=C(C)C)c1OC)C=CC(C)(C)O4

Standard InChI:  InChI=1S/C28H30O8/c1-7-33-22(29)14-34-21-13-19-23(17(27(21)32-6)9-8-15(2)3)26(31)24-20(35-19)12-18-16(25(24)30)10-11-28(4,5)36-18/h8,10-13,30H,7,9,14H2,1-6H3

Standard InChI Key:  ZPVZCTQAQOOJJN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   52.0191  -30.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.7336  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.0191  -31.3921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   51.3047  -30.1546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   53.4481  -30.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   56.3060  -28.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.0204  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.7349  -28.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   58.4494  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   58.4494  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.7349  -30.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.0204  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.3060  -30.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   55.5915  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.8770  -30.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.1626  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.1626  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.8770  -28.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   55.5915  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.1639  -28.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.8783  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.8783  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.1639  -30.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   56.3060  -28.0921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   54.8770  -28.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.1626  -27.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.1626  -26.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.8770  -26.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.4481  -26.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.1605  -30.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.6908  -30.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.4481  -28.9171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   52.7336  -29.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.7349  -28.0921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   50.5902  -30.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.8757  -30.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
  6 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
  9 20  1  0
 10 23  1  0
  6 24  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 18 25  1  0
 22 30  1  0
 22 31  1  0
 32 33  1  0
 17 32  1  0
  8 34  1  0
  5 16  1  0
  2  5  1  0
 35 36  1  0
  4 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533012

    ---

Associated Targets(Human)

PDE4D Tclin Phosphodiesterase 4D (3546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.54Molecular Weight (Monoisotopic): 494.1941AlogP: 5.30#Rotatable Bonds: 7
Polar Surface Area: 104.43Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.24CX Basic pKa: CX LogP: 5.60CX LogD: 5.54
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: 1.99

References

1. Liang J, Huang YY, Zhou Q, Gao Y, Li Z, Wu D, Yu S, Guo L, Chen Z, Huang L, Liang SH, He X, Wu R, Luo HB..  (2020)  Discovery and Optimization of α-Mangostin Derivatives as Novel PDE4 Inhibitors for the Treatment of Vascular Dementia.,  63  (6): [PMID:32115956] [10.1021/acs.jmedchem.0c00060]

Source