5-Hydroxy-2-methyl-4-oxo-N-phenethyl-4H-pyran-3-carboxamide

ID: ALA4533050

PubChem CID: 130407621

Max Phase: Preclinical

Molecular Formula: C15H15NO4

Molecular Weight: 273.29

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1occ(O)c(=O)c1C(=O)NCCc1ccccc1

Standard InChI:  InChI=1S/C15H15NO4/c1-10-13(14(18)12(17)9-20-10)15(19)16-8-7-11-5-3-2-4-6-11/h2-6,9,17H,7-8H2,1H3,(H,16,19)

Standard InChI Key:  MSXQPBGWMRKMCS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   18.9308  -12.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9308  -13.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6425  -13.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3583  -13.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3583  -12.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6425  -11.8166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2149  -13.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2149  -14.2957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5033  -13.0582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7875  -13.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6425  -14.2957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2149  -11.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0742  -13.4707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0733  -13.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3586  -13.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6484  -13.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9341  -13.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9330  -14.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6521  -14.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3635  -14.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  9 10  1  0
  3 11  2  0
  1 12  1  0
  4 13  1  0
 10 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533050

    ---

Associated Targets(non-human)

PA Polymerase acidic protein (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 273.29Molecular Weight (Monoisotopic): 273.1001AlogP: 1.63#Rotatable Bonds: 4
Polar Surface Area: 79.54Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.95CX Basic pKa: CX LogP: 1.56CX LogD: 1.55
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.89Np Likeness Score: -0.13

References

1. Credille CV, Chen Y, Cohen SM..  (2016)  Fragment-Based Identification of Influenza Endonuclease Inhibitors.,  59  (13): [PMID:27291165] [10.1021/acs.jmedchem.6b00628]

Source