Benzyl ((S)-1-(((S,E)-1-(4-Methoxypyridin-2-yl)-5-phenylpent-1-en-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)carbamate

ID: ALA4533125

PubChem CID: 155547862

Max Phase: Preclinical

Molecular Formula: C34H35N3O4

Molecular Weight: 549.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccnc(/C=C/[C@H](CCc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)c1

Standard InChI:  InChI=1S/C34H35N3O4/c1-40-31-21-22-35-30(24-31)20-19-29(18-17-26-11-5-2-6-12-26)36-33(38)32(23-27-13-7-3-8-14-27)37-34(39)41-25-28-15-9-4-10-16-28/h2-16,19-22,24,29,32H,17-18,23,25H2,1H3,(H,36,38)(H,37,39)/b20-19+/t29-,32-/m0/s1

Standard InChI Key:  JMRMIWJJXJFXPZ-LKPJRBBTSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   10.8381   -7.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4704   -8.2579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1765   -7.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8858   -8.2525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1734   -7.0294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5919   -7.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3012   -8.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0073   -7.8359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3043   -9.0644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7166   -8.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4227   -7.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7197   -9.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1320   -8.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5888   -7.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2950   -6.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0018   -7.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7075   -6.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7049   -5.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9907   -5.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2879   -5.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5469   -8.2340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2526   -7.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2499   -7.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5356   -6.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8329   -7.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4289   -9.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4269  -10.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7168  -10.6861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7145  -11.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4216  -11.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1325  -11.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1314  -10.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7626   -7.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0585   -8.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3539   -7.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6504   -8.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6510   -9.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3612   -9.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0618   -9.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5296   -5.7825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2343   -5.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 10 12  1  6
 11 13  2  0
 13  1  1  0
  6 14  1  1
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  1 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25  1  1  0
 12 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  2 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 24 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533125

    ---

Associated Targets(non-human)

Cruzipain (33337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.67Molecular Weight (Monoisotopic): 549.2628AlogP: 5.76#Rotatable Bonds: 13
Polar Surface Area: 89.55Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.26CX Basic pKa: 6.22CX LogP: 6.37CX LogD: 6.34
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: 0.00

References

1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD..  (2020)  Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity.,  63  (6): [PMID:32125159] [10.1021/acs.jmedchem.9b02078]

Source