N-cyclohexyl-2-((5-((2-oxobenzo[d]thiazol-3(2H)-yl)methyl)-4-phenethyl-4H-1,2,4-triazol-3-yl)thio)acetamide

ID: ALA4533128

PubChem CID: 44914508

Max Phase: Preclinical

Molecular Formula: C26H29N5O2S2

Molecular Weight: 507.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nnc(Cn2c(=O)sc3ccccc32)n1CCc1ccccc1)NC1CCCCC1

Standard InChI:  InChI=1S/C26H29N5O2S2/c32-24(27-20-11-5-2-6-12-20)18-34-25-29-28-23(30(25)16-15-19-9-3-1-4-10-19)17-31-21-13-7-8-14-22(21)35-26(31)33/h1,3-4,7-10,13-14,20H,2,5-6,11-12,15-18H2,(H,27,32)

Standard InChI Key:  VXCJXDXJLQECJS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   25.8392   -9.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8380   -9.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5461  -10.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5443   -8.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2529   -9.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2577   -9.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0421  -10.0791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5221   -9.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0343   -8.7472    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.3393   -9.4054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2991  -10.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0995  -11.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4354  -11.7619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2476  -11.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4128  -10.8714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7027  -10.4671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0311  -12.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4439  -13.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0396  -13.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2249  -13.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8206  -14.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2336  -15.3048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0549  -15.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4555  -14.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7979  -12.2759    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.5962  -12.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1466  -12.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9449  -12.5309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8986  -13.4841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4952  -13.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2429  -13.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7894  -14.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5889  -14.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8391  -13.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2897  -12.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

RAD51 Tchem DNA repair protein RAD51 homolog 1 (504 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.69Molecular Weight (Monoisotopic): 507.1763AlogP: 4.49#Rotatable Bonds: 9
Polar Surface Area: 81.81Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.05CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -2.12

References

1. Roberti M, Schipani F, Bagnolini G, Milano D, Giacomini E, Falchi F, Balboni A, Manerba M, Farabegoli F, De Franco F, Robertson J, Minucci S, Pallavicini I, Di Stefano G, Girotto S, Pellicciari R, Cavalli A..  (2019)  Rad51/BRCA2 disruptors inhibit homologous recombination and synergize with olaparib in pancreatic cancer cells.,  165  [PMID:30660828] [10.1016/j.ejmech.2019.01.008]

Source