2-(4-fluorophenyl)-3-(4-(methylsulfonyl)phenyl)-1H-indene

ID: ALA4533150

PubChem CID: 155547155

Max Phase: Preclinical

Molecular Formula: C22H17FO2S

Molecular Weight: 364.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1ccc(C2=C(c3ccc(F)cc3)Cc3ccccc32)cc1

Standard InChI:  InChI=1S/C22H17FO2S/c1-26(24,25)19-12-8-16(9-13-19)22-20-5-3-2-4-17(20)14-21(22)15-6-10-18(23)11-7-15/h2-13H,14H2,1H3

Standard InChI Key:  AHRMEDCMOGKIPB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   24.3042  -10.9116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7191  -10.1980    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.8931  -10.1934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4189  -13.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4178  -14.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1336  -14.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8511  -14.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8483  -13.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1318  -12.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5244  -12.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3061  -13.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5320  -11.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8677  -11.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4355  -10.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4343  -11.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1502  -11.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8649  -10.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1485  -10.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7196   -9.3725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7018  -14.4731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.3185  -11.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7903  -12.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6034  -12.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9459  -11.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4650  -10.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6535  -10.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 22  1  0
 21 12  1  0
 12 10  2  0
 10  8  1  0
 12 13  1  0
 14 15  2  0
 15 16  1  0
 16 13  2  0
 13 17  1  0
 17 18  2  0
 18 14  1  0
 14  2  1  0
  2 19  1  0
  5 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533150

    ---

Associated Targets(Human)

PTGS2 Tclin Cyclooxygenase-2 (13999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.44Molecular Weight (Monoisotopic): 364.0933AlogP: 4.74#Rotatable Bonds: 3
Polar Surface Area: 34.14Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.63CX LogD: 4.63
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.61

References

1. Ramajayam R..  (2019)  Medicinal chemistry of vicinal diaryl scaffold: A mini review.,  162  [PMID:30396033] [10.1016/j.ejmech.2018.10.054]

Source