N-[2-[3-(3-Methoxyphenyl)ureido]ethyl]-4-methylbenzenesulfonamide

ID: ALA4533181

PubChem CID: 89717856

Max Phase: Preclinical

Molecular Formula: C17H21N3O4S

Molecular Weight: 363.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=O)NCCNS(=O)(=O)c2ccc(C)cc2)c1

Standard InChI:  InChI=1S/C17H21N3O4S/c1-13-6-8-16(9-7-13)25(22,23)19-11-10-18-17(21)20-14-4-3-5-15(12-14)24-2/h3-9,12,19H,10-11H2,1-2H3,(H2,18,20,21)

Standard InChI Key:  NRZFZAFEZOWVFW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   16.0178  -15.7949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6133  -15.0891    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.2043  -15.7923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9046  -14.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3200  -14.6813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0293  -15.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7354  -14.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4447  -15.0819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1509  -14.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9028  -13.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1950  -13.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4911  -13.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4995  -14.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2079  -15.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7800  -13.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8601  -15.0766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5663  -14.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1478  -13.8534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2738  -15.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9795  -14.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9769  -13.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2627  -13.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5599  -13.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6886  -15.0695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6912  -15.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  4  1  0
 12 15  1  0
  9 16  1  0
 16 17  1  0
  9 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 20 24  1  0
 24 25  1  0
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 363.44Molecular Weight (Monoisotopic): 363.1253AlogP: 2.10#Rotatable Bonds: 7
Polar Surface Area: 96.53Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.40CX Basic pKa: CX LogP: 2.09CX LogD: 2.09
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.66Np Likeness Score: -2.01

References

1.  (2014)  Serine racemase inhibitor, 

Source